C37H33FO9 — CID 23534701
5-(2,5-dioxooxolan-3-yl)-8-[6-[4-[(E)-3-(4-fluorophenyl)-3-oxoprop-1-enyl]phenoxy]hexoxy]-3a,4,5,9b-tetrahydrobenzo[e][2]benzofuran-1,3-dione (PubChem CID 23534701) has the molecular formula C37H33FO9 and a molecular weight of 640.66 g/mol. Its IUPAC name is 5-(2,5-dioxooxolan-3-yl)-8-[6-[4-[(E)-3-(4-fluorophenyl)-3-oxoprop-1-enyl]phenoxy]hexoxy]-3a,4,5,9b-tetrahydrobenzo[e][2]benzofuran-1,3-dione.
| Compound Name | 5-(2,5-dioxooxolan-3-yl)-8-[6-[4-[(E)-3-(4-fluorophenyl)-3-oxoprop-1-enyl]phenoxy]hexoxy]-3a,4,5,9b-tetrahydrobenzo[e][2]benzofuran-1,3-dione |
|---|---|
| PubChem CID | 23534701 |
| Molecular Formula | C37H33FO9 |
| Molecular Weight | 640.66 g/mol |
| Exact Mass | 640.21 |
| IUPAC Name | 5-(2,5-dioxooxolan-3-yl)-8-[6-[4-[(E)-3-(4-fluorophenyl)-3-oxoprop-1-enyl]phenoxy]hexoxy]-3a,4,5,9b-tetrahydrobenzo[e][2]benzofuran-1,3-dione |
| SMILES | O=C1CC(C2CC3C(=O)OC(=O)C3c3cc(OCCCCCCOc4ccc(/C=C/C(=O)c5ccc(F)cc5)cc4)ccc32)C(=O)O1 |
| InChI | InChI=1S/C37H33FO9/c38-24-10-8-23(9-11-24)32(39)16-7-22-5-12-25(13-6-22)44-17-3-1-2-4-18-45-26-14-15-27-28(30-21-33(40)46-35(30)41)20-31-34(29(27)19-26)37(43)47-36(31)42/h5-16,19,28,30-31,34H,1-4,17-18,20-21H2/b16-7+ |
| InChIKey | RHLGAJBNSCOJRQ-FRKPEAEDSA-N |
| XLogP | 6.10 |
| TPSA | 122.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 640.66 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|