C41H41FO10 — CID 23534703
5-(2,5-dioxooxolan-3-yl)-8-[10-[4-[(E)-3-(4-fluorophenyl)-3-oxoprop-1-enyl]phenyl]peroxydecoxy]-3a,4,5,9b-tetrahydrobenzo[e][2]benzofuran-1,3-dione (PubChem CID 23534703) has the molecular formula C41H41FO10 and a molecular weight of 712.77 g/mol. Its IUPAC name is 5-(2,5-dioxooxolan-3-yl)-8-[10-[4-[(E)-3-(4-fluorophenyl)-3-oxoprop-1-enyl]phenyl]peroxydecoxy]-3a,4,5,9b-tetrahydrobenzo[e][2]benzofuran-1,3-dione.
| Compound Name | 5-(2,5-dioxooxolan-3-yl)-8-[10-[4-[(E)-3-(4-fluorophenyl)-3-oxoprop-1-enyl]phenyl]peroxydecoxy]-3a,4,5,9b-tetrahydrobenzo[e][2]benzofuran-1,3-dione |
|---|---|
| PubChem CID | 23534703 |
| Molecular Formula | C41H41FO10 |
| Molecular Weight | 712.77 g/mol |
| Exact Mass | 712.27 |
| IUPAC Name | 5-(2,5-dioxooxolan-3-yl)-8-[10-[4-[(E)-3-(4-fluorophenyl)-3-oxoprop-1-enyl]phenyl]peroxydecoxy]-3a,4,5,9b-tetrahydrobenzo[e][2]benzofuran-1,3-dione |
| SMILES | O=C1CC(C2CC3C(=O)OC(=O)C3c3cc(OCCCCCCCCCCOOc4ccc(/C=C/C(=O)c5ccc(F)cc5)cc4)ccc32)C(=O)O1 |
| InChI | InChI=1S/C41H41FO10/c42-28-14-12-27(13-15-28)36(43)20-11-26-9-16-29(17-10-26)52-49-22-8-6-4-2-1-3-5-7-21-48-30-18-19-31-32(34-25-37(44)50-39(34)45)24-35-38(33(31)23-30)41(47)51-40(35)46/h9-20,23,32,34-35,38H,1-8,21-22,24-25H2/b20-11+ |
| InChIKey | KFMDYEOZIYAPGQ-RGVLZGJSSA-N |
| XLogP | 7.59 |
| TPSA | 131.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 712.77 |
| LogP ≤ 5 | 7.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|