C41H39FO11 — CID 23534704
[5-(2,5-dioxooxolan-3-yl)-1,3-dioxo-3a,4,5,9b-tetrahydrobenzo[e][2]benzofuran-8-yl] 10-[4-[(E)-3-(4-fluorophenyl)-3-oxoprop-1-enyl]phenyl]peroxydecanoate (PubChem CID 23534704) has the molecular formula C41H39FO11 and a molecular weight of 726.75 g/mol. Its IUPAC name is [5-(2,5-dioxooxolan-3-yl)-1,3-dioxo-3a,4,5,9b-tetrahydrobenzo[e][2]benzofuran-8-yl] 10-[4-[(E)-3-(4-fluorophenyl)-3-oxoprop-1-enyl]phenyl]peroxydecanoate.
| Compound Name | [5-(2,5-dioxooxolan-3-yl)-1,3-dioxo-3a,4,5,9b-tetrahydrobenzo[e][2]benzofuran-8-yl] 10-[4-[(E)-3-(4-fluorophenyl)-3-oxoprop-1-enyl]phenyl]peroxydecanoate |
|---|---|
| PubChem CID | 23534704 |
| Molecular Formula | C41H39FO11 |
| Molecular Weight | 726.75 g/mol |
| Exact Mass | 726.25 |
| IUPAC Name | [5-(2,5-dioxooxolan-3-yl)-1,3-dioxo-3a,4,5,9b-tetrahydrobenzo[e][2]benzofuran-8-yl] 10-[4-[(E)-3-(4-fluorophenyl)-3-oxoprop-1-enyl]phenyl]peroxydecanoate |
| SMILES | O=C1CC(C2CC3C(=O)OC(=O)C3c3cc(OC(=O)CCCCCCCCCOOc4ccc(/C=C/C(=O)c5ccc(F)cc5)cc4)ccc32)C(=O)O1 |
| InChI | InChI=1S/C41H39FO11/c42-27-14-12-26(13-15-27)35(43)20-11-25-9-16-28(17-10-25)53-49-21-7-5-3-1-2-4-6-8-36(44)50-29-18-19-30-31(33-24-37(45)51-39(33)46)23-34-38(32(30)22-29)41(48)52-40(34)47/h9-20,22,31,33-34,38H,1-8,21,23-24H2/b20-11+ |
| InChIKey | JKVFAXVEIXLXBZ-RGVLZGJSSA-N |
| XLogP | 7.12 |
| TPSA | 148.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 53 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 726.75 |
| LogP ≤ 5 | 7.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|