C39H37FO10 — CID 23534705
5-(2,5-dioxooxolan-3-yl)-8-[8-[4-[(E)-3-(4-fluorophenyl)-3-oxoprop-1-enyl]phenyl]peroxyoctoxy]-3a,4,5,9b-tetrahydrobenzo[e][2]benzofuran-1,3-dione (PubChem CID 23534705) has the molecular formula C39H37FO10 and a molecular weight of 684.71 g/mol. Its IUPAC name is 5-(2,5-dioxooxolan-3-yl)-8-[8-[4-[(E)-3-(4-fluorophenyl)-3-oxoprop-1-enyl]phenyl]peroxyoctoxy]-3a,4,5,9b-tetrahydrobenzo[e][2]benzofuran-1,3-dione.
| Compound Name | 5-(2,5-dioxooxolan-3-yl)-8-[8-[4-[(E)-3-(4-fluorophenyl)-3-oxoprop-1-enyl]phenyl]peroxyoctoxy]-3a,4,5,9b-tetrahydrobenzo[e][2]benzofuran-1,3-dione |
|---|---|
| PubChem CID | 23534705 |
| Molecular Formula | C39H37FO10 |
| Molecular Weight | 684.71 g/mol |
| Exact Mass | 684.24 |
| IUPAC Name | 5-(2,5-dioxooxolan-3-yl)-8-[8-[4-[(E)-3-(4-fluorophenyl)-3-oxoprop-1-enyl]phenyl]peroxyoctoxy]-3a,4,5,9b-tetrahydrobenzo[e][2]benzofuran-1,3-dione |
| SMILES | O=C1CC(C2CC3C(=O)OC(=O)C3c3cc(OCCCCCCCCOOc4ccc(/C=C/C(=O)c5ccc(F)cc5)cc4)ccc32)C(=O)O1 |
| InChI | InChI=1S/C39H37FO10/c40-26-12-10-25(11-13-26)34(41)18-9-24-7-14-27(15-8-24)50-47-20-6-4-2-1-3-5-19-46-28-16-17-29-30(32-23-35(42)48-37(32)43)22-33-36(31(29)21-28)39(45)49-38(33)44/h7-18,21,30,32-33,36H,1-6,19-20,22-23H2/b18-9+ |
| InChIKey | MPOSZGXZLHGEHT-GIJQJNRQSA-N |
| XLogP | 6.81 |
| TPSA | 131.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 684.71 |
| LogP ≤ 5 | 6.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|