C16H34S — CID 23534912
4,4,5,5,7,8,8-heptamethylnonane-1-thiol (PubChem CID 23534912) has the molecular formula C16H34S and a molecular weight of 258.51 g/mol. Its IUPAC name is 4,4,5,5,7,8,8-heptamethylnonane-1-thiol.
| Compound Name | 4,4,5,5,7,8,8-heptamethylnonane-1-thiol |
|---|---|
| PubChem CID | 23534912 |
| Molecular Formula | C16H34S |
| Molecular Weight | 258.51 g/mol |
| Exact Mass | 258.24 |
| IUPAC Name | 4,4,5,5,7,8,8-heptamethylnonane-1-thiol |
| SMILES | CC(CC(C)(C)C(C)(C)CCCS)C(C)(C)C |
| InChI | InChI=1S/C16H34S/c1-13(14(2,3)4)12-16(7,8)15(5,6)10-9-11-17/h13,17H,9-12H2,1-8H3 |
| InChIKey | AOMDQISAVCYGTN-UHFFFAOYSA-N |
| XLogP | 5.82 |
| TPSA | 0.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.51 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|