C22H21F9O4S — CID 23535460
(13-methyl-17-oxo-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-3-yl) 1,1,2,2,3,3,4,4,4-nonafluorobutane-1-sulfonate (PubChem CID 23535460) has the molecular formula C22H21F9O4S and a molecular weight of 552.46 g/mol. Its IUPAC name is (13-methyl-17-oxo-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-3-yl) 1,1,2,2,3,3,4,4,4-nonafluorobutane-1-sulfonate.
| Compound Name | (13-methyl-17-oxo-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-3-yl) 1,1,2,2,3,3,4,4,4-nonafluorobutane-1-sulfonate |
|---|---|
| PubChem CID | 23535460 |
| Molecular Formula | C22H21F9O4S |
| Molecular Weight | 552.46 g/mol |
| Exact Mass | 552.10 |
| IUPAC Name | (13-methyl-17-oxo-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-3-yl) 1,1,2,2,3,3,4,4,4-nonafluorobutane-1-sulfonate |
| SMILES | CC12CCC3c4ccc(OS(=O)(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)cc4CCC3C1CCC2=O |
| InChI | InChI=1S/C22H21F9O4S/c1-18-9-8-14-13-5-3-12(10-11(13)2-4-15(14)16(18)6-7-17(18)32)35-36(33,34)22(30,31)20(25,26)19(23,24)21(27,28)29/h3,5,10,14-16H,2,4,6-9H2,1H3 |
| InChIKey | IULIORVYRGYRAS-UHFFFAOYSA-N |
| XLogP | 6.25 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.46 |
| LogP ≤ 5 | 6.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|