About 1-methyl-3,4,5,6-tetrahydro-2H-cyclopenta[b]azepine
1-methyl-3,4,5,6-tetrahydro-2H-cyclopenta[b]azepine (PubChem CID 23535512) has the molecular formula C10H15N
and a molecular weight of 149.24 g/mol. Its IUPAC name is 1-methyl-3,4,5,6-tetrahydro-2H-cyclopenta[b]azepine.
Analyze 1-methyl-3,4,5,6-tetrahydro-2H-cyclopenta[b]azepine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methyl-3,4,5,6-tetrahydro-2H-cyclopenta[b]azepine?
The IUPAC name of 1-methyl-3,4,5,6-tetrahydro-2H-cyclopenta[b]azepine (CID 23535512) is 1-methyl-3,4,5,6-tetrahydro-2H-cyclopenta[b]azepine.
What is the SMILES notation for 1-methyl-3,4,5,6-tetrahydro-2H-cyclopenta[b]azepine?
The canonical SMILES for 1-methyl-3,4,5,6-tetrahydro-2H-cyclopenta[b]azepine is CN1CCCCC2=C1C=CC2.
What is the InChIKey of 1-methyl-3,4,5,6-tetrahydro-2H-cyclopenta[b]azepine?
The InChIKey is XUTNGPRXTUHKMY-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H15N/c1-11-8-3-2-5-9-6-4-7-10(9)11/h4,7H,2-3,5-6,8H2,1H3.
What are the key properties of 1-methyl-3,4,5,6-tetrahydro-2H-cyclopenta[b]azepine?
1-methyl-3,4,5,6-tetrahydro-2H-cyclopenta[b]azepine has a molecular weight of 149.24 g/mol, XLogP of 2.32, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methyl-3,4,5,6-tetrahydro-2H-cyclopenta[b]azepine is sourced from PubChem (CID 23535512), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).