C16H10ClF4N5O — CID 23535954
4-(2-chloro-4-pyridinyl)-N-[3-(1,1,2,2-tetrafluoroethoxy)phenyl]-1,3,5-triazin-2-amine (PubChem CID 23535954) has the molecular formula C16H10ClF4N5O and a molecular weight of 399.74 g/mol. Its IUPAC name is 4-(2-chloro-4-pyridinyl)-N-[3-(1,1,2,2-tetrafluoroethoxy)phenyl]-1,3,5-triazin-2-amine.
| Compound Name | 4-(2-chloro-4-pyridinyl)-N-[3-(1,1,2,2-tetrafluoroethoxy)phenyl]-1,3,5-triazin-2-amine |
|---|---|
| PubChem CID | 23535954 |
| Molecular Formula | C16H10ClF4N5O |
| Molecular Weight | 399.74 g/mol |
| Exact Mass | 399.05 |
| IUPAC Name | 4-(2-chloro-4-pyridinyl)-N-[3-(1,1,2,2-tetrafluoroethoxy)phenyl]-1,3,5-triazin-2-amine |
| SMILES | FC(F)C(F)(F)Oc1cccc(Nc2ncnc(-c3ccnc(Cl)c3)n2)c1 |
| InChI | InChI=1S/C16H10ClF4N5O/c17-12-6-9(4-5-22-12)13-23-8-24-15(26-13)25-10-2-1-3-11(7-10)27-16(20,21)14(18)19/h1-8,14H,(H,23,24,25,26) |
| InChIKey | MOCZFGMVOTVWBO-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 72.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.74 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|