C18H17FN4O3 — CID 23536001
4-(3-fluorophenyl)-N-(3,4,5-trimethoxyphenyl)-1,3,5-triazin-2-amine (PubChem CID 23536001) has the molecular formula C18H17FN4O3 and a molecular weight of 356.36 g/mol. Its IUPAC name is 4-(3-fluorophenyl)-N-(3,4,5-trimethoxyphenyl)-1,3,5-triazin-2-amine.
| Compound Name | 4-(3-fluorophenyl)-N-(3,4,5-trimethoxyphenyl)-1,3,5-triazin-2-amine |
|---|---|
| PubChem CID | 23536001 |
| Molecular Formula | C18H17FN4O3 |
| Molecular Weight | 356.36 g/mol |
| Exact Mass | 356.13 |
| IUPAC Name | 4-(3-fluorophenyl)-N-(3,4,5-trimethoxyphenyl)-1,3,5-triazin-2-amine |
| SMILES | COc1cc(Nc2ncnc(-c3cccc(F)c3)n2)cc(OC)c1OC |
| InChI | InChI=1S/C18H17FN4O3/c1-24-14-8-13(9-15(25-2)16(14)26-3)22-18-21-10-20-17(23-18)11-5-4-6-12(19)7-11/h4-10H,1-3H3,(H,20,21,22,23) |
| InChIKey | PPJRWTGWPAQGDL-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 78.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.36 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |