C20H18FN5O3 — CID 23536086
4-(6-fluoroindol-1-yl)-N-(3,4,5-trimethoxyphenyl)-1,3,5-triazin-2-amine (PubChem CID 23536086) has the molecular formula C20H18FN5O3 and a molecular weight of 395.39 g/mol. Its IUPAC name is 4-(6-fluoroindol-1-yl)-N-(3,4,5-trimethoxyphenyl)-1,3,5-triazin-2-amine.
| Compound Name | 4-(6-fluoroindol-1-yl)-N-(3,4,5-trimethoxyphenyl)-1,3,5-triazin-2-amine |
|---|---|
| PubChem CID | 23536086 |
| Molecular Formula | C20H18FN5O3 |
| Molecular Weight | 395.39 g/mol |
| Exact Mass | 395.14 |
| IUPAC Name | 4-(6-fluoroindol-1-yl)-N-(3,4,5-trimethoxyphenyl)-1,3,5-triazin-2-amine |
| SMILES | COc1cc(Nc2ncnc(-n3ccc4ccc(F)cc43)n2)cc(OC)c1OC |
| InChI | InChI=1S/C20H18FN5O3/c1-27-16-9-14(10-17(28-2)18(16)29-3)24-19-22-11-23-20(25-19)26-7-6-12-4-5-13(21)8-15(12)26/h4-11H,1-3H3,(H,22,23,24,25) |
| InChIKey | BKUOTWXGIWMAGH-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 83.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.39 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |