C22H25N5O3 — CID 23536094
4-(6-methyl-3,4-dihydro-2H-quinolin-1-yl)-N-(3,4,5-trimethoxyphenyl)-1,3,5-triazin-2-amine (PubChem CID 23536094) has the molecular formula C22H25N5O3 and a molecular weight of 407.47 g/mol. Its IUPAC name is 4-(6-methyl-3,4-dihydro-2H-quinolin-1-yl)-N-(3,4,5-trimethoxyphenyl)-1,3,5-triazin-2-amine.
| Compound Name | 4-(6-methyl-3,4-dihydro-2H-quinolin-1-yl)-N-(3,4,5-trimethoxyphenyl)-1,3,5-triazin-2-amine |
|---|---|
| PubChem CID | 23536094 |
| Molecular Formula | C22H25N5O3 |
| Molecular Weight | 407.47 g/mol |
| Exact Mass | 407.20 |
| IUPAC Name | 4-(6-methyl-3,4-dihydro-2H-quinolin-1-yl)-N-(3,4,5-trimethoxyphenyl)-1,3,5-triazin-2-amine |
| SMILES | COc1cc(Nc2ncnc(N3CCCc4cc(C)ccc43)n2)cc(OC)c1OC |
| InChI | InChI=1S/C22H25N5O3/c1-14-7-8-17-15(10-14)6-5-9-27(17)22-24-13-23-21(26-22)25-16-11-18(28-2)20(30-4)19(12-16)29-3/h7-8,10-13H,5-6,9H2,1-4H3,(H,23,24,25,26) |
| InChIKey | AQKQATGZIKRZMQ-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 81.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.47 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |