C22H22F3N5O3 — CID 23536103
4-[7-(trifluoromethyl)-3,4-dihydro-2H-quinolin-1-yl]-N-(3,4,5-trimethoxyphenyl)-1,3,5-triazin-2-amine (PubChem CID 23536103) has the molecular formula C22H22F3N5O3 and a molecular weight of 461.44 g/mol. Its IUPAC name is 4-[7-(trifluoromethyl)-3,4-dihydro-2H-quinolin-1-yl]-N-(3,4,5-trimethoxyphenyl)-1,3,5-triazin-2-amine.
| Compound Name | 4-[7-(trifluoromethyl)-3,4-dihydro-2H-quinolin-1-yl]-N-(3,4,5-trimethoxyphenyl)-1,3,5-triazin-2-amine |
|---|---|
| PubChem CID | 23536103 |
| Molecular Formula | C22H22F3N5O3 |
| Molecular Weight | 461.44 g/mol |
| Exact Mass | 461.17 |
| IUPAC Name | 4-[7-(trifluoromethyl)-3,4-dihydro-2H-quinolin-1-yl]-N-(3,4,5-trimethoxyphenyl)-1,3,5-triazin-2-amine |
| SMILES | COc1cc(Nc2ncnc(N3CCCc4ccc(C(F)(F)F)cc43)n2)cc(OC)c1OC |
| InChI | InChI=1S/C22H22F3N5O3/c1-31-17-10-15(11-18(32-2)19(17)33-3)28-20-26-12-27-21(29-20)30-8-4-5-13-6-7-14(9-16(13)30)22(23,24)25/h6-7,9-12H,4-5,8H2,1-3H3,(H,26,27,28,29) |
| InChIKey | ZVTKDCPKHJJPQF-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 81.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.44 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |