C18H17F2N5O3 — CID 23536328
2-N-(2,5-difluorophenyl)-4-N-(3,4,5-trimethoxyphenyl)-1,3,5-triazine-2,4-diamine (PubChem CID 23536328) has the molecular formula C18H17F2N5O3 and a molecular weight of 389.36 g/mol. Its IUPAC name is 2-N-(2,5-difluorophenyl)-4-N-(3,4,5-trimethoxyphenyl)-1,3,5-triazine-2,4-diamine.
| Compound Name | 2-N-(2,5-difluorophenyl)-4-N-(3,4,5-trimethoxyphenyl)-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 23536328 |
| Molecular Formula | C18H17F2N5O3 |
| Molecular Weight | 389.36 g/mol |
| Exact Mass | 389.13 |
| IUPAC Name | 2-N-(2,5-difluorophenyl)-4-N-(3,4,5-trimethoxyphenyl)-1,3,5-triazine-2,4-diamine |
| SMILES | COc1cc(Nc2ncnc(Nc3cc(F)ccc3F)n2)cc(OC)c1OC |
| InChI | InChI=1S/C18H17F2N5O3/c1-26-14-7-11(8-15(27-2)16(14)28-3)23-17-21-9-22-18(25-17)24-13-6-10(19)4-5-12(13)20/h4-9H,1-3H3,(H2,21,22,23,24,25) |
| InChIKey | GWVZRFMWDLJKOT-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 90.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.36 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |