C22H26FN5O4 — CID 23536382
4-N-[3,4-bis(2-methoxyethoxy)phenyl]-2-N-(3-fluoro-4-methylphenyl)-1,3,5-triazine-2,4-diamine (PubChem CID 23536382) has the molecular formula C22H26FN5O4 and a molecular weight of 443.48 g/mol. Its IUPAC name is 4-N-[3,4-bis(2-methoxyethoxy)phenyl]-2-N-(3-fluoro-4-methylphenyl)-1,3,5-triazine-2,4-diamine.
| Compound Name | 4-N-[3,4-bis(2-methoxyethoxy)phenyl]-2-N-(3-fluoro-4-methylphenyl)-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 23536382 |
| Molecular Formula | C22H26FN5O4 |
| Molecular Weight | 443.48 g/mol |
| Exact Mass | 443.20 |
| IUPAC Name | 4-N-[3,4-bis(2-methoxyethoxy)phenyl]-2-N-(3-fluoro-4-methylphenyl)-1,3,5-triazine-2,4-diamine |
| SMILES | COCCOc1ccc(Nc2ncnc(Nc3ccc(C)c(F)c3)n2)cc1OCCOC |
| InChI | InChI=1S/C22H26FN5O4/c1-15-4-5-16(12-18(15)23)26-21-24-14-25-22(28-21)27-17-6-7-19(31-10-8-29-2)20(13-17)32-11-9-30-3/h4-7,12-14H,8-11H2,1-3H3,(H2,24,25,26,27,28) |
| InChIKey | FHPCKFWTZIZJQS-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 99.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.48 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|