C21H20N6O3 — CID 23536542
2-N-quinolin-3-yl-4-N-(3,4,5-trimethoxyphenyl)-1,3,5-triazine-2,4-diamine (PubChem CID 23536542) has the molecular formula C21H20N6O3 and a molecular weight of 404.43 g/mol. Its IUPAC name is 2-N-quinolin-3-yl-4-N-(3,4,5-trimethoxyphenyl)-1,3,5-triazine-2,4-diamine.
| Compound Name | 2-N-quinolin-3-yl-4-N-(3,4,5-trimethoxyphenyl)-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 23536542 |
| Molecular Formula | C21H20N6O3 |
| Molecular Weight | 404.43 g/mol |
| Exact Mass | 404.16 |
| IUPAC Name | 2-N-quinolin-3-yl-4-N-(3,4,5-trimethoxyphenyl)-1,3,5-triazine-2,4-diamine |
| SMILES | COc1cc(Nc2ncnc(Nc3cnc4ccccc4c3)n2)cc(OC)c1OC |
| InChI | InChI=1S/C21H20N6O3/c1-28-17-9-14(10-18(29-2)19(17)30-3)25-20-23-12-24-21(27-20)26-15-8-13-6-4-5-7-16(13)22-11-15/h4-12H,1-3H3,(H2,23,24,25,26,27) |
| InChIKey | MTMFBNKTKJENJB-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 103.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.43 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |