C22H18N8 — CID 23536548
N-[4-[2-(benzylamino)-3-pyridinyl]-1,3,5-triazin-2-yl]-1H-indazol-5-amine (PubChem CID 23536548) has the molecular formula C22H18N8 and a molecular weight of 394.44 g/mol. Its IUPAC name is N-[4-[2-(benzylamino)-3-pyridinyl]-1,3,5-triazin-2-yl]-1H-indazol-5-amine.
| Compound Name | N-[4-[2-(benzylamino)-3-pyridinyl]-1,3,5-triazin-2-yl]-1H-indazol-5-amine |
|---|---|
| PubChem CID | 23536548 |
| Molecular Formula | C22H18N8 |
| Molecular Weight | 394.44 g/mol |
| Exact Mass | 394.17 |
| IUPAC Name | N-[4-[2-(benzylamino)-3-pyridinyl]-1,3,5-triazin-2-yl]-1H-indazol-5-amine |
| SMILES | c1ccc(CNc2ncccc2-c2ncnc(Nc3ccc4[nH]ncc4c3)n2)cc1 |
| InChI | InChI=1S/C22H18N8/c1-2-5-15(6-3-1)12-24-20-18(7-4-10-23-20)21-25-14-26-22(29-21)28-17-8-9-19-16(11-17)13-27-30-19/h1-11,13-14H,12H2,(H,23,24)(H,27,30)(H,25,26,28,29) |
| InChIKey | HREQMPLXHLAHEN-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 104.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.44 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |