C30H33F3N6O2 — CID 23537189
N-[4-tert-butyl-3-(3-morpholin-4-ylpropoxy)phenyl]-7-[3-(trifluoromethyl)-2-pyridinyl]pyrido[3,2-d]pyrimidin-4-amine (PubChem CID 23537189) has the molecular formula C30H33F3N6O2 and a molecular weight of 566.63 g/mol. Its IUPAC name is N-[4-tert-butyl-3-(3-morpholin-4-ylpropoxy)phenyl]-7-[3-(trifluoromethyl)-2-pyridinyl]pyrido[3,2-d]pyrimidin-4-amine.
| Compound Name | N-[4-tert-butyl-3-(3-morpholin-4-ylpropoxy)phenyl]-7-[3-(trifluoromethyl)-2-pyridinyl]pyrido[3,2-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 23537189 |
| Molecular Formula | C30H33F3N6O2 |
| Molecular Weight | 566.63 g/mol |
| Exact Mass | 566.26 |
| IUPAC Name | N-[4-tert-butyl-3-(3-morpholin-4-ylpropoxy)phenyl]-7-[3-(trifluoromethyl)-2-pyridinyl]pyrido[3,2-d]pyrimidin-4-amine |
| SMILES | CC(C)(C)c1ccc(Nc2ncnc3cc(-c4ncccc4C(F)(F)F)cnc23)cc1OCCCN1CCOCC1 |
| InChI | InChI=1S/C30H33F3N6O2/c1-29(2,3)22-8-7-21(17-25(22)41-13-5-10-39-11-14-40-15-12-39)38-28-27-24(36-19-37-28)16-20(18-35-27)26-23(30(31,32)33)6-4-9-34-26/h4,6-9,16-19H,5,10-15H2,1-3H3,(H,36,37,38) |
| InChIKey | FCTOQQIEBKOIGP-UHFFFAOYSA-N |
| XLogP | 6.25 |
| TPSA | 85.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.63 |
| LogP ≤ 5 | 6.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|