C21H19BrFN3O — CID 23537265
1-(6-bromoquinolin-4-yl)-N-(4-fluorophenyl)piperidine-4-carboxamide (PubChem CID 23537265) has the molecular formula C21H19BrFN3O and a molecular weight of 428.31 g/mol. Its IUPAC name is 1-(6-bromoquinolin-4-yl)-N-(4-fluorophenyl)piperidine-4-carboxamide.
| Compound Name | 1-(6-bromoquinolin-4-yl)-N-(4-fluorophenyl)piperidine-4-carboxamide |
|---|---|
| PubChem CID | 23537265 |
| Molecular Formula | C21H19BrFN3O |
| Molecular Weight | 428.31 g/mol |
| Exact Mass | 427.07 |
| IUPAC Name | 1-(6-bromoquinolin-4-yl)-N-(4-fluorophenyl)piperidine-4-carboxamide |
| SMILES | O=C(Nc1ccc(F)cc1)C1CCN(c2ccnc3ccc(Br)cc23)CC1 |
| InChI | InChI=1S/C21H19BrFN3O/c22-15-1-6-19-18(13-15)20(7-10-24-19)26-11-8-14(9-12-26)21(27)25-17-4-2-16(23)3-5-17/h1-7,10,13-14H,8-9,11-12H2,(H,25,27) |
| InChIKey | UGKBKSDKKUOZRT-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.31 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |