C46H33F4N5O — CID 23537319
2-fluoro-N-[1-[4-(trifluoromethyl)phenyl]cyclopropyl]-4-[6-(1-tritylpyrazol-4-yl)imidazo[1,2-a]pyridin-3-yl]benzamide (PubChem CID 23537319) has the molecular formula C46H33F4N5O and a molecular weight of 747.80 g/mol. Its IUPAC name is 2-fluoro-N-[1-[4-(trifluoromethyl)phenyl]cyclopropyl]-4-[6-(1-tritylpyrazol-4-yl)imidazo[1,2-a]pyridin-3-yl]benzamide.
| Compound Name | 2-fluoro-N-[1-[4-(trifluoromethyl)phenyl]cyclopropyl]-4-[6-(1-tritylpyrazol-4-yl)imidazo[1,2-a]pyridin-3-yl]benzamide |
|---|---|
| PubChem CID | 23537319 |
| Molecular Formula | C46H33F4N5O |
| Molecular Weight | 747.80 g/mol |
| Exact Mass | 747.26 |
| IUPAC Name | 2-fluoro-N-[1-[4-(trifluoromethyl)phenyl]cyclopropyl]-4-[6-(1-tritylpyrazol-4-yl)imidazo[1,2-a]pyridin-3-yl]benzamide |
| SMILES | O=C(NC1(c2ccc(C(F)(F)F)cc2)CC1)c1ccc(-c2cnc3ccc(-c4cnn(C(c5ccccc5)(c5ccccc5)c5ccccc5)c4)cn23)cc1F |
| InChI | InChI=1S/C46H33F4N5O/c47-40-26-31(16-22-39(40)43(56)53-44(24-25-44)34-18-20-38(21-19-34)46(48,49)50)41-28-51-42-23-17-32(29-54(41)42)33-27-52-55(30-33)45(35-10-4-1-5-11-35,36-12-6-2-7-13-36)37-14-8-3-9-15-37/h1-23,26-30H,24-25H2,(H,53,56) |
| InChIKey | JLVILMJKOJVGBD-UHFFFAOYSA-N |
| XLogP | 10.28 |
| TPSA | 64.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 747.80 |
| LogP ≤ 5 | 10.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|