C43H29F4N5O — CID 23537340
2-fluoro-N-[3-(trifluoromethyl)phenyl]-4-[6-(1-tritylpyrazol-4-yl)imidazo[1,2-a]pyridin-3-yl]benzamide (PubChem CID 23537340) has the molecular formula C43H29F4N5O and a molecular weight of 707.73 g/mol. Its IUPAC name is 2-fluoro-N-[3-(trifluoromethyl)phenyl]-4-[6-(1-tritylpyrazol-4-yl)imidazo[1,2-a]pyridin-3-yl]benzamide.
| Compound Name | 2-fluoro-N-[3-(trifluoromethyl)phenyl]-4-[6-(1-tritylpyrazol-4-yl)imidazo[1,2-a]pyridin-3-yl]benzamide |
|---|---|
| PubChem CID | 23537340 |
| Molecular Formula | C43H29F4N5O |
| Molecular Weight | 707.73 g/mol |
| Exact Mass | 707.23 |
| IUPAC Name | 2-fluoro-N-[3-(trifluoromethyl)phenyl]-4-[6-(1-tritylpyrazol-4-yl)imidazo[1,2-a]pyridin-3-yl]benzamide |
| SMILES | O=C(Nc1cccc(C(F)(F)F)c1)c1ccc(-c2cnc3ccc(-c4cnn(C(c5ccccc5)(c5ccccc5)c5ccccc5)c4)cn23)cc1F |
| InChI | InChI=1S/C43H29F4N5O/c44-38-23-29(19-21-37(38)41(53)50-36-18-10-17-35(24-36)43(45,46)47)39-26-48-40-22-20-30(27-51(39)40)31-25-49-52(28-31)42(32-11-4-1-5-12-32,33-13-6-2-7-14-33)34-15-8-3-9-16-34/h1-28H,(H,50,53) |
| InChIKey | DYWQNAMBPNJEIU-UHFFFAOYSA-N |
| XLogP | 10.12 |
| TPSA | 64.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 707.73 |
| LogP ≤ 5 | 10.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|