C40H29FN6OS — CID 23537357
2-fluoro-N-(5-methyl-1,3-thiazol-2-yl)-4-[6-(1-tritylpyrazol-4-yl)imidazo[1,2-a]pyridin-3-yl]benzamide (PubChem CID 23537357) has the molecular formula C40H29FN6OS and a molecular weight of 660.78 g/mol. Its IUPAC name is 2-fluoro-N-(5-methyl-1,3-thiazol-2-yl)-4-[6-(1-tritylpyrazol-4-yl)imidazo[1,2-a]pyridin-3-yl]benzamide.
| Compound Name | 2-fluoro-N-(5-methyl-1,3-thiazol-2-yl)-4-[6-(1-tritylpyrazol-4-yl)imidazo[1,2-a]pyridin-3-yl]benzamide |
|---|---|
| PubChem CID | 23537357 |
| Molecular Formula | C40H29FN6OS |
| Molecular Weight | 660.78 g/mol |
| Exact Mass | 660.21 |
| IUPAC Name | 2-fluoro-N-(5-methyl-1,3-thiazol-2-yl)-4-[6-(1-tritylpyrazol-4-yl)imidazo[1,2-a]pyridin-3-yl]benzamide |
| SMILES | Cc1cnc(NC(=O)c2ccc(-c3cnc4ccc(-c5cnn(C(c6ccccc6)(c6ccccc6)c6ccccc6)c5)cn34)cc2F)s1 |
| InChI | InChI=1S/C40H29FN6OS/c1-27-22-43-39(49-27)45-38(48)34-19-17-28(21-35(34)41)36-24-42-37-20-18-29(25-46(36)37)30-23-44-47(26-30)40(31-11-5-2-6-12-31,32-13-7-3-8-14-32)33-15-9-4-10-16-33/h2-26H,1H3,(H,43,45,48) |
| InChIKey | FYDIXVFICSVHBR-UHFFFAOYSA-N |
| XLogP | 8.86 |
| TPSA | 77.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 660.78 |
| LogP ≤ 5 | 8.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|