C43H33FN4O — CID 23537393
6-[3-(4-fluorophenyl)-1-tritylpyrazol-4-yl]-3-(4-methoxyphenyl)-7-methylimidazo[1,2-a]pyridine (PubChem CID 23537393) has the molecular formula C43H33FN4O and a molecular weight of 640.76 g/mol. Its IUPAC name is 6-[3-(4-fluorophenyl)-1-tritylpyrazol-4-yl]-3-(4-methoxyphenyl)-7-methylimidazo[1,2-a]pyridine.
| Compound Name | 6-[3-(4-fluorophenyl)-1-tritylpyrazol-4-yl]-3-(4-methoxyphenyl)-7-methylimidazo[1,2-a]pyridine |
|---|---|
| PubChem CID | 23537393 |
| Molecular Formula | C43H33FN4O |
| Molecular Weight | 640.76 g/mol |
| Exact Mass | 640.26 |
| IUPAC Name | 6-[3-(4-fluorophenyl)-1-tritylpyrazol-4-yl]-3-(4-methoxyphenyl)-7-methylimidazo[1,2-a]pyridine |
| SMILES | COc1ccc(-c2cnc3cc(C)c(-c4cn(C(c5ccccc5)(c5ccccc5)c5ccccc5)nc4-c4ccc(F)cc4)cn23)cc1 |
| InChI | InChI=1S/C43H33FN4O/c1-30-26-41-45-27-40(31-20-24-37(49-2)25-21-31)47(41)28-38(30)39-29-48(46-42(39)32-18-22-36(44)23-19-32)43(33-12-6-3-7-13-33,34-14-8-4-9-15-34)35-16-10-5-11-17-35/h3-29H,1-2H3 |
| InChIKey | ODJKGHHQWKZOFP-UHFFFAOYSA-N |
| XLogP | 9.83 |
| TPSA | 44.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 640.76 |
| LogP ≤ 5 | 9.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|