C44H34F4N4O — CID 23537510
(4-fluorophenyl)-[1-[6-[3-(trifluoromethyl)-1-tritylpyrazol-4-yl]quinolin-4-yl]piperidin-4-yl]methanone (PubChem CID 23537510) has the molecular formula C44H34F4N4O and a molecular weight of 710.78 g/mol. Its IUPAC name is (4-fluorophenyl)-[1-[6-[3-(trifluoromethyl)-1-tritylpyrazol-4-yl]quinolin-4-yl]piperidin-4-yl]methanone.
| Compound Name | (4-fluorophenyl)-[1-[6-[3-(trifluoromethyl)-1-tritylpyrazol-4-yl]quinolin-4-yl]piperidin-4-yl]methanone |
|---|---|
| PubChem CID | 23537510 |
| Molecular Formula | C44H34F4N4O |
| Molecular Weight | 710.78 g/mol |
| Exact Mass | 710.27 |
| IUPAC Name | (4-fluorophenyl)-[1-[6-[3-(trifluoromethyl)-1-tritylpyrazol-4-yl]quinolin-4-yl]piperidin-4-yl]methanone |
| SMILES | O=C(c1ccc(F)cc1)C1CCN(c2ccnc3ccc(-c4cn(C(c5ccccc5)(c5ccccc5)c5ccccc5)nc4C(F)(F)F)cc23)CC1 |
| InChI | InChI=1S/C44H34F4N4O/c45-36-19-16-30(17-20-36)41(53)31-23-26-51(27-24-31)40-22-25-49-39-21-18-32(28-37(39)40)38-29-52(50-42(38)44(46,47)48)43(33-10-4-1-5-11-33,34-12-6-2-7-13-34)35-14-8-3-9-15-35/h1-22,25,28-29,31H,23-24,26-27H2 |
| InChIKey | ZSJLJESFVFHLQI-UHFFFAOYSA-N |
| XLogP | 10.20 |
| TPSA | 51.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 710.78 |
| LogP ≤ 5 | 10.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|