About 6-[5-(2,6-difluorophenyl)-1H-pyrazol-4-yl]-4-(3-methylpyrazol-1-yl)quinazoline
6-[5-(2,6-difluorophenyl)-1H-pyrazol-4-yl]-4-(3-methylpyrazol-1-yl)quinazoline (PubChem CID 23537583) has the molecular formula C21H14F2N6
and a molecular weight of 388.38 g/mol. Its IUPAC name is 6-[5-(2,6-difluorophenyl)-1H-pyrazol-4-yl]-4-(3-methylpyrazol-1-yl)quinazoline.
Molecular Properties
| Compound Name | 6-[5-(2,6-difluorophenyl)-1H-pyrazol-4-yl]-4-(3-methylpyrazol-1-yl)quinazoline |
| PubChem CID | 23537583 |
| Molecular Formula | C21H14F2N6 |
| Molecular Weight | 388.38 g/mol |
| Exact Mass | 388.12 |
| IUPAC Name | 6-[5-(2,6-difluorophenyl)-1H-pyrazol-4-yl]-4-(3-methylpyrazol-1-yl)quinazoline |
| SMILES | Cc1ccn(-c2ncnc3ccc(-c4cn[nH]c4-c4c(F)cccc4F)cc23)n1 |
| InChI | InChI=1S/C21H14F2N6/c1-12-7-8-29(28-12)21-14-9-13(5-6-18(14)24-11-25-21)15-10-26-27-20(15)19-16(22)3-2-4-17(19)23/h2-11H,1H3,(H,26,27) |
| InChIKey | SSHRRFNBSZUGOB-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 72.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 388.38 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 6-[5-(2,6-difluorophenyl)-1H-pyrazol-4-yl]-4-(3-methylpyrazol-1-yl)quinazoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-[5-(2,6-difluorophenyl)-1H-pyrazol-4-yl]-4-(3-methylpyrazol-1-yl)quinazoline?
The IUPAC name of 6-[5-(2,6-difluorophenyl)-1H-pyrazol-4-yl]-4-(3-methylpyrazol-1-yl)quinazoline (CID 23537583) is 6-[5-(2,6-difluorophenyl)-1H-pyrazol-4-yl]-4-(3-methylpyrazol-1-yl)quinazoline.
What is the SMILES notation for 6-[5-(2,6-difluorophenyl)-1H-pyrazol-4-yl]-4-(3-methylpyrazol-1-yl)quinazoline?
The canonical SMILES for 6-[5-(2,6-difluorophenyl)-1H-pyrazol-4-yl]-4-(3-methylpyrazol-1-yl)quinazoline is Cc1ccn(-c2ncnc3ccc(-c4cn[nH]c4-c4c(F)cccc4F)cc23)n1.
What is the InChIKey of 6-[5-(2,6-difluorophenyl)-1H-pyrazol-4-yl]-4-(3-methylpyrazol-1-yl)quinazoline?
The InChIKey is SSHRRFNBSZUGOB-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H14F2N6/c1-12-7-8-29(28-12)21-14-9-13(5-6-18(14)24-11-25-21)15-10-26-27-20(15)19-16(22)3-2-4-17(19)23/h2-11H,1H3,(H,26,27).
What are the key properties of 6-[5-(2,6-difluorophenyl)-1H-pyrazol-4-yl]-4-(3-methylpyrazol-1-yl)quinazoline?
6-[5-(2,6-difluorophenyl)-1H-pyrazol-4-yl]-4-(3-methylpyrazol-1-yl)quinazoline has a molecular weight of 388.38 g/mol, XLogP of 4.46, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 6-[5-(2,6-difluorophenyl)-1H-pyrazol-4-yl]-4-(3-methylpyrazol-1-yl)quinazoline is sourced from PubChem (CID 23537583), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).