C40H28F2N6 — CID 23537591
6-[3-(2,6-difluorophenyl)-1-tritylpyrazol-4-yl]-4-(4-methylimidazol-1-yl)quinazoline (PubChem CID 23537591) has the molecular formula C40H28F2N6 and a molecular weight of 630.70 g/mol. Its IUPAC name is 6-[3-(2,6-difluorophenyl)-1-tritylpyrazol-4-yl]-4-(4-methylimidazol-1-yl)quinazoline.
| Compound Name | 6-[3-(2,6-difluorophenyl)-1-tritylpyrazol-4-yl]-4-(4-methylimidazol-1-yl)quinazoline |
|---|---|
| PubChem CID | 23537591 |
| Molecular Formula | C40H28F2N6 |
| Molecular Weight | 630.70 g/mol |
| Exact Mass | 630.23 |
| IUPAC Name | 6-[3-(2,6-difluorophenyl)-1-tritylpyrazol-4-yl]-4-(4-methylimidazol-1-yl)quinazoline |
| SMILES | Cc1cn(-c2ncnc3ccc(-c4cn(C(c5ccccc5)(c5ccccc5)c5ccccc5)nc4-c4c(F)cccc4F)cc23)cn1 |
| InChI | InChI=1S/C40H28F2N6/c1-27-23-47(26-45-27)39-32-22-28(20-21-36(32)43-25-44-39)33-24-48(46-38(33)37-34(41)18-11-19-35(37)42)40(29-12-5-2-6-13-29,30-14-7-3-8-15-30)31-16-9-4-10-17-31/h2-26H,1H3 |
| InChIKey | JVOBXZHRONSACZ-UHFFFAOYSA-N |
| XLogP | 8.77 |
| TPSA | 61.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 630.70 |
| LogP ≤ 5 | 8.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|