C40H28F2N6O — CID 23537672
2-cyclopropyl-5-[6-[3-(2,4-difluorophenyl)-1-tritylpyrazol-4-yl]imidazo[1,2-a]pyridin-3-yl]-1,3,4-oxadiazole (PubChem CID 23537672) has the molecular formula C40H28F2N6O and a molecular weight of 646.70 g/mol. Its IUPAC name is 2-cyclopropyl-5-[6-[3-(2,4-difluorophenyl)-1-tritylpyrazol-4-yl]imidazo[1,2-a]pyridin-3-yl]-1,3,4-oxadiazole.
| Compound Name | 2-cyclopropyl-5-[6-[3-(2,4-difluorophenyl)-1-tritylpyrazol-4-yl]imidazo[1,2-a]pyridin-3-yl]-1,3,4-oxadiazole |
|---|---|
| PubChem CID | 23537672 |
| Molecular Formula | C40H28F2N6O |
| Molecular Weight | 646.70 g/mol |
| Exact Mass | 646.23 |
| IUPAC Name | 2-cyclopropyl-5-[6-[3-(2,4-difluorophenyl)-1-tritylpyrazol-4-yl]imidazo[1,2-a]pyridin-3-yl]-1,3,4-oxadiazole |
| SMILES | Fc1ccc(-c2nn(C(c3ccccc3)(c3ccccc3)c3ccccc3)cc2-c2ccc3ncc(-c4nnc(C5CC5)o4)n3c2)c(F)c1 |
| InChI | InChI=1S/C40H28F2N6O/c41-31-19-20-32(34(42)22-31)37-33(27-18-21-36-43-23-35(47(36)24-27)39-45-44-38(49-39)26-16-17-26)25-48(46-37)40(28-10-4-1-5-11-28,29-12-6-2-7-13-29)30-14-8-3-9-15-30/h1-15,18-26H,16-17H2 |
| InChIKey | YYWBJVCEZNFNAK-UHFFFAOYSA-N |
| XLogP | 8.91 |
| TPSA | 74.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 646.70 |
| LogP ≤ 5 | 8.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|