C42H28F3N5O — CID 23537705
N-(2,3-difluorophenyl)-2-fluoro-4-[6-(1-tritylpyrazol-4-yl)imidazo[1,2-a]pyridin-3-yl]benzamide (PubChem CID 23537705) has the molecular formula C42H28F3N5O and a molecular weight of 675.71 g/mol. Its IUPAC name is N-(2,3-difluorophenyl)-2-fluoro-4-[6-(1-tritylpyrazol-4-yl)imidazo[1,2-a]pyridin-3-yl]benzamide.
| Compound Name | N-(2,3-difluorophenyl)-2-fluoro-4-[6-(1-tritylpyrazol-4-yl)imidazo[1,2-a]pyridin-3-yl]benzamide |
|---|---|
| PubChem CID | 23537705 |
| Molecular Formula | C42H28F3N5O |
| Molecular Weight | 675.71 g/mol |
| Exact Mass | 675.22 |
| IUPAC Name | N-(2,3-difluorophenyl)-2-fluoro-4-[6-(1-tritylpyrazol-4-yl)imidazo[1,2-a]pyridin-3-yl]benzamide |
| SMILES | O=C(Nc1cccc(F)c1F)c1ccc(-c2cnc3ccc(-c4cnn(C(c5ccccc5)(c5ccccc5)c5ccccc5)c4)cn23)cc1F |
| InChI | InChI=1S/C42H28F3N5O/c43-35-17-10-18-37(40(35)45)48-41(51)34-21-19-28(23-36(34)44)38-25-46-39-22-20-29(26-49(38)39)30-24-47-50(27-30)42(31-11-4-1-5-12-31,32-13-6-2-7-14-32)33-15-8-3-9-16-33/h1-27H,(H,48,51) |
| InChIKey | CZNHVWUOCLYPBU-UHFFFAOYSA-N |
| XLogP | 9.37 |
| TPSA | 64.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 675.71 |
| LogP ≤ 5 | 9.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|