C48H42FN5O2 — CID 23537713
N-[1-(4-ethylphenyl)-1-hydroxy-2-methylpropan-2-yl]-2-fluoro-4-[6-(1-tritylpyrazol-4-yl)imidazo[1,2-a]pyridin-3-yl]benzamide (PubChem CID 23537713) has the molecular formula C48H42FN5O2 and a molecular weight of 739.89 g/mol. Its IUPAC name is N-[1-(4-ethylphenyl)-1-hydroxy-2-methylpropan-2-yl]-2-fluoro-4-[6-(1-tritylpyrazol-4-yl)imidazo[1,2-a]pyridin-3-yl]benzamide.
| Compound Name | N-[1-(4-ethylphenyl)-1-hydroxy-2-methylpropan-2-yl]-2-fluoro-4-[6-(1-tritylpyrazol-4-yl)imidazo[1,2-a]pyridin-3-yl]benzamide |
|---|---|
| PubChem CID | 23537713 |
| Molecular Formula | C48H42FN5O2 |
| Molecular Weight | 739.89 g/mol |
| Exact Mass | 739.33 |
| IUPAC Name | N-[1-(4-ethylphenyl)-1-hydroxy-2-methylpropan-2-yl]-2-fluoro-4-[6-(1-tritylpyrazol-4-yl)imidazo[1,2-a]pyridin-3-yl]benzamide |
| SMILES | CCc1ccc(C(O)C(C)(C)NC(=O)c2ccc(-c3cnc4ccc(-c5cnn(C(c6ccccc6)(c6ccccc6)c6ccccc6)c5)cn34)cc2F)cc1 |
| InChI | InChI=1S/C48H42FN5O2/c1-4-33-20-22-34(23-21-33)45(55)47(2,3)52-46(56)41-26-24-35(28-42(41)49)43-30-50-44-27-25-36(31-53(43)44)37-29-51-54(32-37)48(38-14-8-5-9-15-38,39-16-10-6-11-17-39)40-18-12-7-13-19-40/h5-32,45,55H,4H2,1-3H3,(H,52,56) |
| InChIKey | FYCSNCWRIRGDRN-UHFFFAOYSA-N |
| XLogP | 9.65 |
| TPSA | 84.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 739.89 |
| LogP ≤ 5 | 9.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|