C42H34N6OS2 — CID 23537778
N-cyclopentyl-5-[4-[3-(1,3-thiazol-2-yl)imidazo[1,2-a]pyridin-6-yl]-1-tritylpyrazol-3-yl]thiophene-2-carboxamide (PubChem CID 23537778) has the molecular formula C42H34N6OS2 and a molecular weight of 702.91 g/mol. Its IUPAC name is N-cyclopentyl-5-[4-[3-(1,3-thiazol-2-yl)imidazo[1,2-a]pyridin-6-yl]-1-tritylpyrazol-3-yl]thiophene-2-carboxamide.
| Compound Name | N-cyclopentyl-5-[4-[3-(1,3-thiazol-2-yl)imidazo[1,2-a]pyridin-6-yl]-1-tritylpyrazol-3-yl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 23537778 |
| Molecular Formula | C42H34N6OS2 |
| Molecular Weight | 702.91 g/mol |
| Exact Mass | 702.22 |
| IUPAC Name | N-cyclopentyl-5-[4-[3-(1,3-thiazol-2-yl)imidazo[1,2-a]pyridin-6-yl]-1-tritylpyrazol-3-yl]thiophene-2-carboxamide |
| SMILES | O=C(NC1CCCC1)c1ccc(-c2nn(C(c3ccccc3)(c3ccccc3)c3ccccc3)cc2-c2ccc3ncc(-c4nccs4)n3c2)s1 |
| InChI | InChI=1S/C42H34N6OS2/c49-40(45-33-18-10-11-19-33)37-22-21-36(51-37)39-34(29-20-23-38-44-26-35(47(38)27-29)41-43-24-25-50-41)28-48(46-39)42(30-12-4-1-5-13-30,31-14-6-2-7-15-31)32-16-8-3-9-17-32/h1-9,12-17,20-28,33H,10-11,18-19H2,(H,45,49) |
| InChIKey | HWLYCPVQHQUAQA-UHFFFAOYSA-N |
| XLogP | 9.56 |
| TPSA | 77.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 702.91 |
| LogP ≤ 5 | 9.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|