About 3-tert-butyl-4-(2,2-dimethylpropyl)oxane
3-tert-butyl-4-(2,2-dimethylpropyl)oxane (PubChem CID 23537838) has the molecular formula C14H28O
and a molecular weight of 212.38 g/mol. Its IUPAC name is 3-tert-butyl-4-(2,2-dimethylpropyl)oxane.
Molecular Properties
| Compound Name | 3-tert-butyl-4-(2,2-dimethylpropyl)oxane |
| PubChem CID | 23537838 |
| Molecular Formula | C14H28O |
| Molecular Weight | 212.38 g/mol |
| Exact Mass | 212.21 |
| IUPAC Name | 3-tert-butyl-4-(2,2-dimethylpropyl)oxane |
| SMILES | CC(C)(C)CC1CCOCC1C(C)(C)C |
| InChI | InChI=1S/C14H28O/c1-13(2,3)9-11-7-8-15-10-12(11)14(4,5)6/h11-12H,7-10H2,1-6H3 |
| InChIKey | NOWOXPINKUKUFF-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 212.38 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 3-tert-butyl-4-(2,2-dimethylpropyl)oxane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-tert-butyl-4-(2,2-dimethylpropyl)oxane?
The IUPAC name of 3-tert-butyl-4-(2,2-dimethylpropyl)oxane (CID 23537838) is 3-tert-butyl-4-(2,2-dimethylpropyl)oxane.
What is the SMILES notation for 3-tert-butyl-4-(2,2-dimethylpropyl)oxane?
The canonical SMILES for 3-tert-butyl-4-(2,2-dimethylpropyl)oxane is CC(C)(C)CC1CCOCC1C(C)(C)C.
What is the InChIKey of 3-tert-butyl-4-(2,2-dimethylpropyl)oxane?
The InChIKey is NOWOXPINKUKUFF-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H28O/c1-13(2,3)9-11-7-8-15-10-12(11)14(4,5)6/h11-12H,7-10H2,1-6H3.
What are the key properties of 3-tert-butyl-4-(2,2-dimethylpropyl)oxane?
3-tert-butyl-4-(2,2-dimethylpropyl)oxane has a molecular weight of 212.38 g/mol, XLogP of 4.12, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-tert-butyl-4-(2,2-dimethylpropyl)oxane is sourced from PubChem (CID 23537838), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).