C40H55F5O9S — CID 23538033
diethyl 2-[4-[7-(methoxymethoxy)-3-[4-(methoxymethoxy)phenyl]-3-methyl-2,4-dihydrochromen-4-yl]butyl]-2-[4-(4,4,5,5,5-pentafluoropentylsulfanyl)butyl]propanedioate (PubChem CID 23538033) has the molecular formula C40H55F5O9S and a molecular weight of 806.93 g/mol. Its IUPAC name is diethyl 2-[4-[7-(methoxymethoxy)-3-[4-(methoxymethoxy)phenyl]-3-methyl-2,4-dihydrochromen-4-yl]butyl]-2-[4-(4,4,5,5,5-pentafluoropentylsulfanyl)butyl]propanedioate.
| Compound Name | diethyl 2-[4-[7-(methoxymethoxy)-3-[4-(methoxymethoxy)phenyl]-3-methyl-2,4-dihydrochromen-4-yl]butyl]-2-[4-(4,4,5,5,5-pentafluoropentylsulfanyl)butyl]propanedioate |
|---|---|
| PubChem CID | 23538033 |
| Molecular Formula | C40H55F5O9S |
| Molecular Weight | 806.93 g/mol |
| Exact Mass | 806.35 |
| IUPAC Name | diethyl 2-[4-[7-(methoxymethoxy)-3-[4-(methoxymethoxy)phenyl]-3-methyl-2,4-dihydrochromen-4-yl]butyl]-2-[4-(4,4,5,5,5-pentafluoropentylsulfanyl)butyl]propanedioate |
| SMILES | CCOC(=O)C(CCCCSCCCC(F)(F)C(F)(F)F)(CCCCC1c2ccc(OCOC)cc2OCC1(C)c1ccc(OCOC)cc1)C(=O)OCC |
| InChI | InChI=1S/C40H55F5O9S/c1-6-50-35(46)38(36(47)51-7-2,21-10-11-23-55-24-12-22-39(41,42)40(43,44)45)20-9-8-13-33-32-19-18-31(54-28-49-5)25-34(32)52-26-37(33,3)29-14-16-30(17-15-29)53-27-48-4/h14-19,25,33H,6-13,20-24,26-28H2,1-5H3 |
| InChIKey | FJQVOFVNQHBRHN-UHFFFAOYSA-N |
| XLogP | 9.64 |
| TPSA | 98.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 25 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 806.93 |
| LogP ≤ 5 | 9.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|