C14H26F5NOS — CID 23538060
N-butyl-5-(4,4,5,5,5-pentafluoropentylsulfinyl)pentan-1-amine (PubChem CID 23538060) has the molecular formula C14H26F5NOS and a molecular weight of 351.43 g/mol. Its IUPAC name is N-butyl-5-(4,4,5,5,5-pentafluoropentylsulfinyl)pentan-1-amine.
| Compound Name | N-butyl-5-(4,4,5,5,5-pentafluoropentylsulfinyl)pentan-1-amine |
|---|---|
| PubChem CID | 23538060 |
| Molecular Formula | C14H26F5NOS |
| Molecular Weight | 351.43 g/mol |
| Exact Mass | 351.17 |
| IUPAC Name | N-butyl-5-(4,4,5,5,5-pentafluoropentylsulfinyl)pentan-1-amine |
| SMILES | CCCCNCCCCCS(=O)CCCC(F)(F)C(F)(F)F |
| InChI | InChI=1S/C14H26F5NOS/c1-2-3-9-20-10-5-4-6-11-22(21)12-7-8-13(15,16)14(17,18)19/h20H,2-12H2,1H3 |
| InChIKey | LSMSXALXVQJWNG-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.43 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|