C30H25F5O12S3 — CID 23538144
[4-[2,5-dimethoxy-3-methylsulfonyloxy-4-[3-methylsulfonyloxy-4-[(2,3,4,5,6-pentafluorophenyl)methoxy]phenyl]phenyl]phenyl] methanesulfonate (PubChem CID 23538144) has the molecular formula C30H25F5O12S3 and a molecular weight of 768.71 g/mol. Its IUPAC name is [4-[2,5-dimethoxy-3-methylsulfonyloxy-4-[3-methylsulfonyloxy-4-[(2,3,4,5,6-pentafluorophenyl)methoxy]phenyl]phenyl]phenyl] methanesulfonate.
| Compound Name | [4-[2,5-dimethoxy-3-methylsulfonyloxy-4-[3-methylsulfonyloxy-4-[(2,3,4,5,6-pentafluorophenyl)methoxy]phenyl]phenyl]phenyl] methanesulfonate |
|---|---|
| PubChem CID | 23538144 |
| Molecular Formula | C30H25F5O12S3 |
| Molecular Weight | 768.71 g/mol |
| Exact Mass | 768.04 |
| IUPAC Name | [4-[2,5-dimethoxy-3-methylsulfonyloxy-4-[3-methylsulfonyloxy-4-[(2,3,4,5,6-pentafluorophenyl)methoxy]phenyl]phenyl]phenyl] methanesulfonate |
| SMILES | COc1cc(-c2ccc(OS(C)(=O)=O)cc2)c(OC)c(OS(C)(=O)=O)c1-c1ccc(OCc2c(F)c(F)c(F)c(F)c2F)c(OS(C)(=O)=O)c1 |
| InChI | InChI=1S/C30H25F5O12S3/c1-42-22-13-18(15-6-9-17(10-7-15)45-48(3,36)37)29(43-2)30(47-50(5,40)41)23(22)16-8-11-20(21(12-16)46-49(4,38)39)44-14-19-24(31)26(33)28(35)27(34)25(19)32/h6-13H,14H2,1-5H3 |
| InChIKey | KGBLYIYHIGDKJP-UHFFFAOYSA-N |
| XLogP | 5.33 |
| TPSA | 157.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 50 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 768.71 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|