About 2-[3-fluoro-4-(pyridin-2-ylmethoxy)phenyl]-5-(4-hydroxyphenyl)-3,6-dimethoxybenzoic acid
2-[3-fluoro-4-(pyridin-2-ylmethoxy)phenyl]-5-(4-hydroxyphenyl)-3,6-dimethoxybenzoic acid (PubChem CID 23538343) has the molecular formula C27H22FNO6
and a molecular weight of 475.47 g/mol. Its IUPAC name is 2-[3-fluoro-4-(pyridin-2-ylmethoxy)phenyl]-5-(4-hydroxyphenyl)-3,6-dimethoxybenzoic acid.
Molecular Properties
| Compound Name | 2-[3-fluoro-4-(pyridin-2-ylmethoxy)phenyl]-5-(4-hydroxyphenyl)-3,6-dimethoxybenzoic acid |
| PubChem CID | 23538343 |
| Molecular Formula | C27H22FNO6 |
| Molecular Weight | 475.47 g/mol |
| Exact Mass | 475.14 |
| IUPAC Name | 2-[3-fluoro-4-(pyridin-2-ylmethoxy)phenyl]-5-(4-hydroxyphenyl)-3,6-dimethoxybenzoic acid |
| SMILES | COc1cc(-c2ccc(O)cc2)c(OC)c(C(=O)O)c1-c1ccc(OCc2ccccn2)c(F)c1 |
| InChI | InChI=1S/C27H22FNO6/c1-33-23-14-20(16-6-9-19(30)10-7-16)26(34-2)25(27(31)32)24(23)17-8-11-22(21(28)13-17)35-15-18-5-3-4-12-29-18/h3-14,30H,15H2,1-2H3,(H,31,32) |
| InChIKey | IHZDBZHZFUKKER-UHFFFAOYSA-N |
| XLogP | 5.55 |
| TPSA | 98.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 475.47 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 2-[3-fluoro-4-(pyridin-2-ylmethoxy)phenyl]-5-(4-hydroxyphenyl)-3,6-dimethoxybenzoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[3-fluoro-4-(pyridin-2-ylmethoxy)phenyl]-5-(4-hydroxyphenyl)-3,6-dimethoxybenzoic acid?
The IUPAC name of 2-[3-fluoro-4-(pyridin-2-ylmethoxy)phenyl]-5-(4-hydroxyphenyl)-3,6-dimethoxybenzoic acid (CID 23538343) is 2-[3-fluoro-4-(pyridin-2-ylmethoxy)phenyl]-5-(4-hydroxyphenyl)-3,6-dimethoxybenzoic acid.
What is the SMILES notation for 2-[3-fluoro-4-(pyridin-2-ylmethoxy)phenyl]-5-(4-hydroxyphenyl)-3,6-dimethoxybenzoic acid?
The canonical SMILES for 2-[3-fluoro-4-(pyridin-2-ylmethoxy)phenyl]-5-(4-hydroxyphenyl)-3,6-dimethoxybenzoic acid is COc1cc(-c2ccc(O)cc2)c(OC)c(C(=O)O)c1-c1ccc(OCc2ccccn2)c(F)c1.
What is the InChIKey of 2-[3-fluoro-4-(pyridin-2-ylmethoxy)phenyl]-5-(4-hydroxyphenyl)-3,6-dimethoxybenzoic acid?
The InChIKey is IHZDBZHZFUKKER-UHFFFAOYSA-N. The full InChI is InChI=1S/C27H22FNO6/c1-33-23-14-20(16-6-9-19(30)10-7-16)26(34-2)25(27(31)32)24(23)17-8-11-22(21(28)13-17)35-15-18-5-3-4-12-29-18/h3-14,30H,15H2,1-2H3,(H,31,32).
What are the key properties of 2-[3-fluoro-4-(pyridin-2-ylmethoxy)phenyl]-5-(4-hydroxyphenyl)-3,6-dimethoxybenzoic acid?
2-[3-fluoro-4-(pyridin-2-ylmethoxy)phenyl]-5-(4-hydroxyphenyl)-3,6-dimethoxybenzoic acid has a molecular weight of 475.47 g/mol, XLogP of 5.55, 8 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[3-fluoro-4-(pyridin-2-ylmethoxy)phenyl]-5-(4-hydroxyphenyl)-3,6-dimethoxybenzoic acid is sourced from PubChem (CID 23538343), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).