About 2-bromo-1,4-dimethoxy-3-(methoxymethoxy)-5-(4-methoxyphenyl)benzene
2-bromo-1,4-dimethoxy-3-(methoxymethoxy)-5-(4-methoxyphenyl)benzene (PubChem CID 23538777) has the molecular formula C17H19BrO5
and a molecular weight of 383.24 g/mol. Its IUPAC name is 2-bromo-1,4-dimethoxy-3-(methoxymethoxy)-5-(4-methoxyphenyl)benzene.
Molecular Properties
| Compound Name | 2-bromo-1,4-dimethoxy-3-(methoxymethoxy)-5-(4-methoxyphenyl)benzene |
| PubChem CID | 23538777 |
| Molecular Formula | C17H19BrO5 |
| Molecular Weight | 383.24 g/mol |
| Exact Mass | 382.04 |
| IUPAC Name | 2-bromo-1,4-dimethoxy-3-(methoxymethoxy)-5-(4-methoxyphenyl)benzene |
| SMILES | COCOc1c(Br)c(OC)cc(-c2ccc(OC)cc2)c1OC |
| InChI | InChI=1S/C17H19BrO5/c1-19-10-23-17-15(18)14(21-3)9-13(16(17)22-4)11-5-7-12(20-2)8-6-11/h5-9H,10H2,1-4H3 |
| InChIKey | SJELKDQVUVHFOC-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 383.24 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 2-bromo-1,4-dimethoxy-3-(methoxymethoxy)-5-(4-methoxyphenyl)benzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-bromo-1,4-dimethoxy-3-(methoxymethoxy)-5-(4-methoxyphenyl)benzene?
The IUPAC name of 2-bromo-1,4-dimethoxy-3-(methoxymethoxy)-5-(4-methoxyphenyl)benzene (CID 23538777) is 2-bromo-1,4-dimethoxy-3-(methoxymethoxy)-5-(4-methoxyphenyl)benzene.
What is the SMILES notation for 2-bromo-1,4-dimethoxy-3-(methoxymethoxy)-5-(4-methoxyphenyl)benzene?
The canonical SMILES for 2-bromo-1,4-dimethoxy-3-(methoxymethoxy)-5-(4-methoxyphenyl)benzene is COCOc1c(Br)c(OC)cc(-c2ccc(OC)cc2)c1OC.
What is the InChIKey of 2-bromo-1,4-dimethoxy-3-(methoxymethoxy)-5-(4-methoxyphenyl)benzene?
The InChIKey is SJELKDQVUVHFOC-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H19BrO5/c1-19-10-23-17-15(18)14(21-3)9-13(16(17)22-4)11-5-7-12(20-2)8-6-11/h5-9H,10H2,1-4H3.
What are the key properties of 2-bromo-1,4-dimethoxy-3-(methoxymethoxy)-5-(4-methoxyphenyl)benzene?
2-bromo-1,4-dimethoxy-3-(methoxymethoxy)-5-(4-methoxyphenyl)benzene has a molecular weight of 383.24 g/mol, XLogP of 4.12, 7 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-bromo-1,4-dimethoxy-3-(methoxymethoxy)-5-(4-methoxyphenyl)benzene is sourced from PubChem (CID 23538777), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).