C18H18F2N4OS — CID 2353878
4-[4-(difluoromethoxy)phenyl]-2-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-ylmethyl)-1,3-thiazole (PubChem CID 2353878) has the molecular formula C18H18F2N4OS and a molecular weight of 376.43 g/mol. Its IUPAC name is 4-[4-(difluoromethoxy)phenyl]-2-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-ylmethyl)-1,3-thiazole.
| Compound Name | 4-[4-(difluoromethoxy)phenyl]-2-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-ylmethyl)-1,3-thiazole |
|---|---|
| PubChem CID | 2353878 |
| Molecular Formula | C18H18F2N4OS |
| Molecular Weight | 376.43 g/mol |
| Exact Mass | 376.12 |
| IUPAC Name | 4-[4-(difluoromethoxy)phenyl]-2-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-ylmethyl)-1,3-thiazole |
| SMILES | FC(F)Oc1ccc(-c2csc(Cc3nnc4n3CCCCC4)n2)cc1 |
| InChI | InChI=1S/C18H18F2N4OS/c19-18(20)25-13-7-5-12(6-8-13)14-11-26-17(21-14)10-16-23-22-15-4-2-1-3-9-24(15)16/h5-8,11,18H,1-4,9-10H2 |
| InChIKey | YPZOJRDIUZHPRT-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 52.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.43 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |