About 5-[2,5-dimethoxy-4-(4-methylsulfanylphenyl)phenyl]-1-(4-methylphenyl)sulfonylindole
5-[2,5-dimethoxy-4-(4-methylsulfanylphenyl)phenyl]-1-(4-methylphenyl)sulfonylindole (PubChem CID 23539089) has the molecular formula C30H27NO4S2
and a molecular weight of 529.68 g/mol. Its IUPAC name is 5-[2,5-dimethoxy-4-(4-methylsulfanylphenyl)phenyl]-1-(4-methylphenyl)sulfonylindole.
Molecular Properties
| Compound Name | 5-[2,5-dimethoxy-4-(4-methylsulfanylphenyl)phenyl]-1-(4-methylphenyl)sulfonylindole |
| PubChem CID | 23539089 |
| Molecular Formula | C30H27NO4S2 |
| Molecular Weight | 529.68 g/mol |
| Exact Mass | 529.14 |
| IUPAC Name | 5-[2,5-dimethoxy-4-(4-methylsulfanylphenyl)phenyl]-1-(4-methylphenyl)sulfonylindole |
| SMILES | COc1cc(-c2ccc3c(ccn3S(=O)(=O)c3ccc(C)cc3)c2)c(OC)cc1-c1ccc(SC)cc1 |
| InChI | InChI=1S/C30H27NO4S2/c1-20-5-12-25(13-6-20)37(32,33)31-16-15-23-17-22(9-14-28(23)31)27-19-29(34-2)26(18-30(27)35-3)21-7-10-24(36-4)11-8-21/h5-19H,1-4H3 |
| InChIKey | UHINAQXGGKPTOJ-UHFFFAOYSA-N |
| XLogP | 7.26 |
| TPSA | 57.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 529.68 |
| LogP ≤ 5 | 7.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 5-[2,5-dimethoxy-4-(4-methylsulfanylphenyl)phenyl]-1-(4-methylphenyl)sulfonylindole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[2,5-dimethoxy-4-(4-methylsulfanylphenyl)phenyl]-1-(4-methylphenyl)sulfonylindole?
The IUPAC name of 5-[2,5-dimethoxy-4-(4-methylsulfanylphenyl)phenyl]-1-(4-methylphenyl)sulfonylindole (CID 23539089) is 5-[2,5-dimethoxy-4-(4-methylsulfanylphenyl)phenyl]-1-(4-methylphenyl)sulfonylindole.
What is the SMILES notation for 5-[2,5-dimethoxy-4-(4-methylsulfanylphenyl)phenyl]-1-(4-methylphenyl)sulfonylindole?
The canonical SMILES for 5-[2,5-dimethoxy-4-(4-methylsulfanylphenyl)phenyl]-1-(4-methylphenyl)sulfonylindole is COc1cc(-c2ccc3c(ccn3S(=O)(=O)c3ccc(C)cc3)c2)c(OC)cc1-c1ccc(SC)cc1.
What is the InChIKey of 5-[2,5-dimethoxy-4-(4-methylsulfanylphenyl)phenyl]-1-(4-methylphenyl)sulfonylindole?
The InChIKey is UHINAQXGGKPTOJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C30H27NO4S2/c1-20-5-12-25(13-6-20)37(32,33)31-16-15-23-17-22(9-14-28(23)31)27-19-29(34-2)26(18-30(27)35-3)21-7-10-24(36-4)11-8-21/h5-19H,1-4H3.
What are the key properties of 5-[2,5-dimethoxy-4-(4-methylsulfanylphenyl)phenyl]-1-(4-methylphenyl)sulfonylindole?
5-[2,5-dimethoxy-4-(4-methylsulfanylphenyl)phenyl]-1-(4-methylphenyl)sulfonylindole has a molecular weight of 529.68 g/mol, XLogP of 7.26, 7 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[2,5-dimethoxy-4-(4-methylsulfanylphenyl)phenyl]-1-(4-methylphenyl)sulfonylindole is sourced from PubChem (CID 23539089), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).