About [4-[2,5-dimethoxy-4-[1-(4-methylphenyl)sulfonylindol-5-yl]phenyl]phenyl] methanesulfonate
[4-[2,5-dimethoxy-4-[1-(4-methylphenyl)sulfonylindol-5-yl]phenyl]phenyl] methanesulfonate (PubChem CID 23539092) has the molecular formula C30H27NO7S2
and a molecular weight of 577.68 g/mol. Its IUPAC name is [4-[2,5-dimethoxy-4-[1-(4-methylphenyl)sulfonylindol-5-yl]phenyl]phenyl] methanesulfonate.
Molecular Properties
| Compound Name | [4-[2,5-dimethoxy-4-[1-(4-methylphenyl)sulfonylindol-5-yl]phenyl]phenyl] methanesulfonate |
| PubChem CID | 23539092 |
| Molecular Formula | C30H27NO7S2 |
| Molecular Weight | 577.68 g/mol |
| Exact Mass | 577.12 |
| IUPAC Name | [4-[2,5-dimethoxy-4-[1-(4-methylphenyl)sulfonylindol-5-yl]phenyl]phenyl] methanesulfonate |
| SMILES | COc1cc(-c2ccc3c(ccn3S(=O)(=O)c3ccc(C)cc3)c2)c(OC)cc1-c1ccc(OS(C)(=O)=O)cc1 |
| InChI | InChI=1S/C30H27NO7S2/c1-20-5-12-25(13-6-20)40(34,35)31-16-15-23-17-22(9-14-28(23)31)27-19-29(36-2)26(18-30(27)37-3)21-7-10-24(11-8-21)38-39(4,32)33/h5-19H,1-4H3 |
| InChIKey | NTONIVRUAQKNNR-UHFFFAOYSA-N |
| XLogP | 5.88 |
| TPSA | 100.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 577.68 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|
Analyze [4-[2,5-dimethoxy-4-[1-(4-methylphenyl)sulfonylindol-5-yl]phenyl]phenyl] methanesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-[2,5-dimethoxy-4-[1-(4-methylphenyl)sulfonylindol-5-yl]phenyl]phenyl] methanesulfonate?
The IUPAC name of [4-[2,5-dimethoxy-4-[1-(4-methylphenyl)sulfonylindol-5-yl]phenyl]phenyl] methanesulfonate (CID 23539092) is [4-[2,5-dimethoxy-4-[1-(4-methylphenyl)sulfonylindol-5-yl]phenyl]phenyl] methanesulfonate.
What is the SMILES notation for [4-[2,5-dimethoxy-4-[1-(4-methylphenyl)sulfonylindol-5-yl]phenyl]phenyl] methanesulfonate?
The canonical SMILES for [4-[2,5-dimethoxy-4-[1-(4-methylphenyl)sulfonylindol-5-yl]phenyl]phenyl] methanesulfonate is COc1cc(-c2ccc3c(ccn3S(=O)(=O)c3ccc(C)cc3)c2)c(OC)cc1-c1ccc(OS(C)(=O)=O)cc1.
What is the InChIKey of [4-[2,5-dimethoxy-4-[1-(4-methylphenyl)sulfonylindol-5-yl]phenyl]phenyl] methanesulfonate?
The InChIKey is NTONIVRUAQKNNR-UHFFFAOYSA-N. The full InChI is InChI=1S/C30H27NO7S2/c1-20-5-12-25(13-6-20)40(34,35)31-16-15-23-17-22(9-14-28(23)31)27-19-29(36-2)26(18-30(27)37-3)21-7-10-24(11-8-21)38-39(4,32)33/h5-19H,1-4H3.
What are the key properties of [4-[2,5-dimethoxy-4-[1-(4-methylphenyl)sulfonylindol-5-yl]phenyl]phenyl] methanesulfonate?
[4-[2,5-dimethoxy-4-[1-(4-methylphenyl)sulfonylindol-5-yl]phenyl]phenyl] methanesulfonate has a molecular weight of 577.68 g/mol, XLogP of 5.88, 8 rotatable bonds, 0 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for [4-[2,5-dimethoxy-4-[1-(4-methylphenyl)sulfonylindol-5-yl]phenyl]phenyl] methanesulfonate is sourced from PubChem (CID 23539092), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).