About 5-(4-hydroxyphenyl)-2-[3-hydroxy-4-(pyridin-2-ylmethoxy)phenyl]-3,6-dimethoxyphenol
5-(4-hydroxyphenyl)-2-[3-hydroxy-4-(pyridin-2-ylmethoxy)phenyl]-3,6-dimethoxyphenol (PubChem CID 23539229) has the molecular formula C26H23NO6
and a molecular weight of 445.47 g/mol. Its IUPAC name is 5-(4-hydroxyphenyl)-2-[3-hydroxy-4-(pyridin-2-ylmethoxy)phenyl]-3,6-dimethoxyphenol.
Molecular Properties
| Compound Name | 5-(4-hydroxyphenyl)-2-[3-hydroxy-4-(pyridin-2-ylmethoxy)phenyl]-3,6-dimethoxyphenol |
| PubChem CID | 23539229 |
| Molecular Formula | C26H23NO6 |
| Molecular Weight | 445.47 g/mol |
| Exact Mass | 445.15 |
| IUPAC Name | 5-(4-hydroxyphenyl)-2-[3-hydroxy-4-(pyridin-2-ylmethoxy)phenyl]-3,6-dimethoxyphenol |
| SMILES | COc1cc(-c2ccc(O)cc2)c(OC)c(O)c1-c1ccc(OCc2ccccn2)c(O)c1 |
| InChI | InChI=1S/C26H23NO6/c1-31-23-14-20(16-6-9-19(28)10-7-16)26(32-2)25(30)24(23)17-8-11-22(21(29)13-17)33-15-18-5-3-4-12-27-18/h3-14,28-30H,15H2,1-2H3 |
| InChIKey | LWFKXNWOKPORJB-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 101.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 445.47 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 5-(4-hydroxyphenyl)-2-[3-hydroxy-4-(pyridin-2-ylmethoxy)phenyl]-3,6-dimethoxyphenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(4-hydroxyphenyl)-2-[3-hydroxy-4-(pyridin-2-ylmethoxy)phenyl]-3,6-dimethoxyphenol?
The IUPAC name of 5-(4-hydroxyphenyl)-2-[3-hydroxy-4-(pyridin-2-ylmethoxy)phenyl]-3,6-dimethoxyphenol (CID 23539229) is 5-(4-hydroxyphenyl)-2-[3-hydroxy-4-(pyridin-2-ylmethoxy)phenyl]-3,6-dimethoxyphenol.
What is the SMILES notation for 5-(4-hydroxyphenyl)-2-[3-hydroxy-4-(pyridin-2-ylmethoxy)phenyl]-3,6-dimethoxyphenol?
The canonical SMILES for 5-(4-hydroxyphenyl)-2-[3-hydroxy-4-(pyridin-2-ylmethoxy)phenyl]-3,6-dimethoxyphenol is COc1cc(-c2ccc(O)cc2)c(OC)c(O)c1-c1ccc(OCc2ccccn2)c(O)c1.
What is the InChIKey of 5-(4-hydroxyphenyl)-2-[3-hydroxy-4-(pyridin-2-ylmethoxy)phenyl]-3,6-dimethoxyphenol?
The InChIKey is LWFKXNWOKPORJB-UHFFFAOYSA-N. The full InChI is InChI=1S/C26H23NO6/c1-31-23-14-20(16-6-9-19(28)10-7-16)26(32-2)25(30)24(23)17-8-11-22(21(29)13-17)33-15-18-5-3-4-12-27-18/h3-14,28-30H,15H2,1-2H3.
What are the key properties of 5-(4-hydroxyphenyl)-2-[3-hydroxy-4-(pyridin-2-ylmethoxy)phenyl]-3,6-dimethoxyphenol?
5-(4-hydroxyphenyl)-2-[3-hydroxy-4-(pyridin-2-ylmethoxy)phenyl]-3,6-dimethoxyphenol has a molecular weight of 445.47 g/mol, XLogP of 5.13, 7 rotatable bonds, 3 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(4-hydroxyphenyl)-2-[3-hydroxy-4-(pyridin-2-ylmethoxy)phenyl]-3,6-dimethoxyphenol is sourced from PubChem (CID 23539229), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).