About methyl 2-(4-fluorophenyl)-3,6-dimethoxy-5-(3-methylsulfonyloxy-4-phenylmethoxyphenyl)benzoate
methyl 2-(4-fluorophenyl)-3,6-dimethoxy-5-(3-methylsulfonyloxy-4-phenylmethoxyphenyl)benzoate (PubChem CID 23539327) has the molecular formula C30H27FO8S
and a molecular weight of 566.60 g/mol. Its IUPAC name is methyl 2-(4-fluorophenyl)-3,6-dimethoxy-5-(3-methylsulfonyloxy-4-phenylmethoxyphenyl)benzoate.
Molecular Properties
| Compound Name | methyl 2-(4-fluorophenyl)-3,6-dimethoxy-5-(3-methylsulfonyloxy-4-phenylmethoxyphenyl)benzoate |
| PubChem CID | 23539327 |
| Molecular Formula | C30H27FO8S |
| Molecular Weight | 566.60 g/mol |
| Exact Mass | 566.14 |
| IUPAC Name | methyl 2-(4-fluorophenyl)-3,6-dimethoxy-5-(3-methylsulfonyloxy-4-phenylmethoxyphenyl)benzoate |
| SMILES | COC(=O)c1c(OC)c(-c2ccc(OCc3ccccc3)c(OS(C)(=O)=O)c2)cc(OC)c1-c1ccc(F)cc1 |
| InChI | InChI=1S/C30H27FO8S/c1-35-26-17-23(29(36-2)28(30(32)37-3)27(26)20-10-13-22(31)14-11-20)21-12-15-24(25(16-21)39-40(4,33)34)38-18-19-8-6-5-7-9-19/h5-17H,18H2,1-4H3 |
| InChIKey | FVVXVOWXVCONCN-UHFFFAOYSA-N |
| XLogP | 5.88 |
| TPSA | 97.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 566.60 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|
Analyze methyl 2-(4-fluorophenyl)-3,6-dimethoxy-5-(3-methylsulfonyloxy-4-phenylmethoxyphenyl)benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-(4-fluorophenyl)-3,6-dimethoxy-5-(3-methylsulfonyloxy-4-phenylmethoxyphenyl)benzoate?
The IUPAC name of methyl 2-(4-fluorophenyl)-3,6-dimethoxy-5-(3-methylsulfonyloxy-4-phenylmethoxyphenyl)benzoate (CID 23539327) is methyl 2-(4-fluorophenyl)-3,6-dimethoxy-5-(3-methylsulfonyloxy-4-phenylmethoxyphenyl)benzoate.
What is the SMILES notation for methyl 2-(4-fluorophenyl)-3,6-dimethoxy-5-(3-methylsulfonyloxy-4-phenylmethoxyphenyl)benzoate?
The canonical SMILES for methyl 2-(4-fluorophenyl)-3,6-dimethoxy-5-(3-methylsulfonyloxy-4-phenylmethoxyphenyl)benzoate is COC(=O)c1c(OC)c(-c2ccc(OCc3ccccc3)c(OS(C)(=O)=O)c2)cc(OC)c1-c1ccc(F)cc1.
What is the InChIKey of methyl 2-(4-fluorophenyl)-3,6-dimethoxy-5-(3-methylsulfonyloxy-4-phenylmethoxyphenyl)benzoate?
The InChIKey is FVVXVOWXVCONCN-UHFFFAOYSA-N. The full InChI is InChI=1S/C30H27FO8S/c1-35-26-17-23(29(36-2)28(30(32)37-3)27(26)20-10-13-22(31)14-11-20)21-12-15-24(25(16-21)39-40(4,33)34)38-18-19-8-6-5-7-9-19/h5-17H,18H2,1-4H3.
What are the key properties of methyl 2-(4-fluorophenyl)-3,6-dimethoxy-5-(3-methylsulfonyloxy-4-phenylmethoxyphenyl)benzoate?
methyl 2-(4-fluorophenyl)-3,6-dimethoxy-5-(3-methylsulfonyloxy-4-phenylmethoxyphenyl)benzoate has a molecular weight of 566.60 g/mol, XLogP of 5.88, 10 rotatable bonds, 0 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-(4-fluorophenyl)-3,6-dimethoxy-5-(3-methylsulfonyloxy-4-phenylmethoxyphenyl)benzoate is sourced from PubChem (CID 23539327), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).