About 4-amino-3-methylbutanal
4-amino-3-methylbutanal (PubChem CID 23539490) has the molecular formula C5H11NO
and a molecular weight of 101.15 g/mol. Its IUPAC name is 4-amino-3-methylbutanal.
Molecular Properties
| Compound Name | 4-amino-3-methylbutanal |
| PubChem CID | 23539490 |
| Molecular Formula | C5H11NO |
| Molecular Weight | 101.15 g/mol |
| Exact Mass | 101.08 |
| IUPAC Name | 4-amino-3-methylbutanal |
| SMILES | CC(CN)CC=O |
| InChI | InChI=1S/C5H11NO/c1-5(4-6)2-3-7/h3,5H,2,4,6H2,1H3 |
| InChIKey | VHMWZILZPVLXBE-UHFFFAOYSA-N |
| XLogP | 0.17 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 101.15 |
| LogP ≤ 5 | 0.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 4-amino-3-methylbutanal with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-amino-3-methylbutanal?
The IUPAC name of 4-amino-3-methylbutanal (CID 23539490) is 4-amino-3-methylbutanal.
What is the SMILES notation for 4-amino-3-methylbutanal?
The canonical SMILES for 4-amino-3-methylbutanal is CC(CN)CC=O.
What is the InChIKey of 4-amino-3-methylbutanal?
The InChIKey is VHMWZILZPVLXBE-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H11NO/c1-5(4-6)2-3-7/h3,5H,2,4,6H2,1H3.
What are the key properties of 4-amino-3-methylbutanal?
4-amino-3-methylbutanal has a molecular weight of 101.15 g/mol, XLogP of 0.17, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-amino-3-methylbutanal is sourced from PubChem (CID 23539490), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).