C22H39NO5S — CID 23539686
3-[3-(1,1-dihexoxyethyl)pyridin-1-ium-1-yl]propane-1-sulfonate (PubChem CID 23539686) has the molecular formula C22H39NO5S and a molecular weight of 429.62 g/mol. Its IUPAC name is 3-[3-(1,1-dihexoxyethyl)pyridin-1-ium-1-yl]propane-1-sulfonate.
| Compound Name | 3-[3-(1,1-dihexoxyethyl)pyridin-1-ium-1-yl]propane-1-sulfonate |
|---|---|
| PubChem CID | 23539686 |
| Molecular Formula | C22H39NO5S |
| Molecular Weight | 429.62 g/mol |
| Exact Mass | 429.25 |
| IUPAC Name | 3-[3-(1,1-dihexoxyethyl)pyridin-1-ium-1-yl]propane-1-sulfonate |
| SMILES | CCCCCCOC(C)(OCCCCCC)c1ccc[n+](CCCS(=O)(=O)[O-])c1 |
| InChI | InChI=1S/C22H39NO5S/c1-4-6-8-10-17-27-22(3,28-18-11-9-7-5-2)21-14-12-15-23(20-21)16-13-19-29(24,25)26/h12,14-15,20H,4-11,13,16-19H2,1-3H3 |
| InChIKey | SVGLXMOOHWRLAY-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 79.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.62 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|