About N-chloro-2,2-dimethoxycyclohexan-1-amine
N-chloro-2,2-dimethoxycyclohexan-1-amine (PubChem CID 23539850) has the molecular formula C8H16ClNO2
and a molecular weight of 193.67 g/mol. Its IUPAC name is N-chloro-2,2-dimethoxycyclohexan-1-amine.
Molecular Properties
| Compound Name | N-chloro-2,2-dimethoxycyclohexan-1-amine |
| PubChem CID | 23539850 |
| Molecular Formula | C8H16ClNO2 |
| Molecular Weight | 193.67 g/mol |
| Exact Mass | 193.09 |
| IUPAC Name | N-chloro-2,2-dimethoxycyclohexan-1-amine |
| SMILES | COC1(OC)CCCCC1NCl |
| InChI | InChI=1S/C8H16ClNO2/c1-11-8(12-2)6-4-3-5-7(8)10-9/h7,10H,3-6H2,1-2H3 |
| InChIKey | DAGKFKUDEYNUTA-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 193.67 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|
Analyze N-chloro-2,2-dimethoxycyclohexan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-chloro-2,2-dimethoxycyclohexan-1-amine?
The IUPAC name of N-chloro-2,2-dimethoxycyclohexan-1-amine (CID 23539850) is N-chloro-2,2-dimethoxycyclohexan-1-amine.
What is the SMILES notation for N-chloro-2,2-dimethoxycyclohexan-1-amine?
The canonical SMILES for N-chloro-2,2-dimethoxycyclohexan-1-amine is COC1(OC)CCCCC1NCl.
What is the InChIKey of N-chloro-2,2-dimethoxycyclohexan-1-amine?
The InChIKey is DAGKFKUDEYNUTA-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H16ClNO2/c1-11-8(12-2)6-4-3-5-7(8)10-9/h7,10H,3-6H2,1-2H3.
What are the key properties of N-chloro-2,2-dimethoxycyclohexan-1-amine?
N-chloro-2,2-dimethoxycyclohexan-1-amine has a molecular weight of 193.67 g/mol, XLogP of 1.66, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-chloro-2,2-dimethoxycyclohexan-1-amine is sourced from PubChem (CID 23539850), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).