C17H8Cl2F8O4S — CID 23539912
4-[3-(2,5-dichlorobenzoyl)phenyl]-1,1,2,2,3,3,4,4-octafluorobutane-1-sulfonic acid (PubChem CID 23539912) has the molecular formula C17H8Cl2F8O4S and a molecular weight of 531.20 g/mol. Its IUPAC name is 4-[3-(2,5-dichlorobenzoyl)phenyl]-1,1,2,2,3,3,4,4-octafluorobutane-1-sulfonic acid.
| Compound Name | 4-[3-(2,5-dichlorobenzoyl)phenyl]-1,1,2,2,3,3,4,4-octafluorobutane-1-sulfonic acid |
|---|---|
| PubChem CID | 23539912 |
| Molecular Formula | C17H8Cl2F8O4S |
| Molecular Weight | 531.20 g/mol |
| Exact Mass | 529.94 |
| IUPAC Name | 4-[3-(2,5-dichlorobenzoyl)phenyl]-1,1,2,2,3,3,4,4-octafluorobutane-1-sulfonic acid |
| SMILES | O=C(c1cccc(C(F)(F)C(F)(F)C(F)(F)C(F)(F)S(=O)(=O)O)c1)c1cc(Cl)ccc1Cl |
| InChI | InChI=1S/C17H8Cl2F8O4S/c18-10-4-5-12(19)11(7-10)13(28)8-2-1-3-9(6-8)14(20,21)15(22,23)16(24,25)17(26,27)32(29,30)31/h1-7H,(H,29,30,31) |
| InChIKey | MKNUWTKCRDLBRN-UHFFFAOYSA-N |
| XLogP | 6.07 |
| TPSA | 71.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.20 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|