C28H33N9O2 — CID 23540117
3-[5-amino-7-[2-[4-[4-(2-methoxyethoxy)phenyl]piperazin-1-yl]ethyl-methylamino]-[1,2,4]triazolo[1,5-c]pyrimidin-2-yl]benzonitrile (PubChem CID 23540117) has the molecular formula C28H33N9O2 and a molecular weight of 527.63 g/mol. Its IUPAC name is 3-[5-amino-7-[2-[4-[4-(2-methoxyethoxy)phenyl]piperazin-1-yl]ethyl-methylamino]-[1,2,4]triazolo[1,5-c]pyrimidin-2-yl]benzonitrile.
| Compound Name | 3-[5-amino-7-[2-[4-[4-(2-methoxyethoxy)phenyl]piperazin-1-yl]ethyl-methylamino]-[1,2,4]triazolo[1,5-c]pyrimidin-2-yl]benzonitrile |
|---|---|
| PubChem CID | 23540117 |
| Molecular Formula | C28H33N9O2 |
| Molecular Weight | 527.63 g/mol |
| Exact Mass | 527.28 |
| IUPAC Name | 3-[5-amino-7-[2-[4-[4-(2-methoxyethoxy)phenyl]piperazin-1-yl]ethyl-methylamino]-[1,2,4]triazolo[1,5-c]pyrimidin-2-yl]benzonitrile |
| SMILES | COCCOc1ccc(N2CCN(CCN(C)c3cc4nc(-c5cccc(C#N)c5)nn4c(N)n3)CC2)cc1 |
| InChI | InChI=1S/C28H33N9O2/c1-34(10-11-35-12-14-36(15-13-35)23-6-8-24(9-7-23)39-17-16-38-2)25-19-26-31-27(33-37(26)28(30)32-25)22-5-3-4-21(18-22)20-29/h3-9,18-19H,10-17H2,1-2H3,(H2,30,32) |
| InChIKey | CALAGWXXGJLXKE-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 121.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.63 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|