About 2-methoxypentan-1-ol
2-methoxypentan-1-ol (PubChem CID 23540330) has the molecular formula C6H14O2
and a molecular weight of 118.18 g/mol. Its IUPAC name is 2-methoxypentan-1-ol.
Molecular Properties
| Compound Name | 2-methoxypentan-1-ol |
| PubChem CID | 23540330 |
| Molecular Formula | C6H14O2 |
| Molecular Weight | 118.18 g/mol |
| Exact Mass | 118.10 |
| IUPAC Name | 2-methoxypentan-1-ol |
| SMILES | CCCC(CO)OC |
| InChI | InChI=1S/C6H14O2/c1-3-4-6(5-7)8-2/h6-7H,3-5H2,1-2H3 |
| InChIKey | WGWLUEYOKURLOE-UHFFFAOYSA-N |
| XLogP | 0.79 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 118.18 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-methoxypentan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methoxypentan-1-ol?
The IUPAC name of 2-methoxypentan-1-ol (CID 23540330) is 2-methoxypentan-1-ol.
What is the SMILES notation for 2-methoxypentan-1-ol?
The canonical SMILES for 2-methoxypentan-1-ol is CCCC(CO)OC.
What is the InChIKey of 2-methoxypentan-1-ol?
The InChIKey is WGWLUEYOKURLOE-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H14O2/c1-3-4-6(5-7)8-2/h6-7H,3-5H2,1-2H3.
What are the key properties of 2-methoxypentan-1-ol?
2-methoxypentan-1-ol has a molecular weight of 118.18 g/mol, XLogP of 0.79, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methoxypentan-1-ol is sourced from PubChem (CID 23540330), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).