C25H16F6N2O2 — CID 23542221
5-[1,1,1,3,3,3-hexafluoro-2-(2-methyl-1,3-benzoxazol-5-yl)propan-2-yl]-2-(3-methylphenyl)-1,3-benzoxazole (PubChem CID 23542221) has the molecular formula C25H16F6N2O2 and a molecular weight of 490.40 g/mol. Its IUPAC name is 5-[1,1,1,3,3,3-hexafluoro-2-(2-methyl-1,3-benzoxazol-5-yl)propan-2-yl]-2-(3-methylphenyl)-1,3-benzoxazole.
| Compound Name | 5-[1,1,1,3,3,3-hexafluoro-2-(2-methyl-1,3-benzoxazol-5-yl)propan-2-yl]-2-(3-methylphenyl)-1,3-benzoxazole |
|---|---|
| PubChem CID | 23542221 |
| Molecular Formula | C25H16F6N2O2 |
| Molecular Weight | 490.40 g/mol |
| Exact Mass | 490.11 |
| IUPAC Name | 5-[1,1,1,3,3,3-hexafluoro-2-(2-methyl-1,3-benzoxazol-5-yl)propan-2-yl]-2-(3-methylphenyl)-1,3-benzoxazole |
| SMILES | Cc1cccc(-c2nc3cc(C(c4ccc5oc(C)nc5c4)(C(F)(F)F)C(F)(F)F)ccc3o2)c1 |
| InChI | InChI=1S/C25H16F6N2O2/c1-13-4-3-5-15(10-13)22-33-19-12-17(7-9-21(19)35-22)23(24(26,27)28,25(29,30)31)16-6-8-20-18(11-16)32-14(2)34-20/h3-12H,1-2H3 |
| InChIKey | DIHALUIAIPGUMF-UHFFFAOYSA-N |
| XLogP | 7.66 |
| TPSA | 52.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.40 |
| LogP ≤ 5 | 7.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |