About N-[3-[1,4-dihydroxybutan-2-yl(methyl)amino]propyl]methanesulfonamide
N-[3-[1,4-dihydroxybutan-2-yl(methyl)amino]propyl]methanesulfonamide (PubChem CID 23542741) has the molecular formula C9H22N2O4S
and a molecular weight of 254.35 g/mol. Its IUPAC name is N-[3-[1,4-dihydroxybutan-2-yl(methyl)amino]propyl]methanesulfonamide.
Molecular Properties
| Compound Name | N-[3-[1,4-dihydroxybutan-2-yl(methyl)amino]propyl]methanesulfonamide |
| PubChem CID | 23542741 |
| Molecular Formula | C9H22N2O4S |
| Molecular Weight | 254.35 g/mol |
| Exact Mass | 254.13 |
| IUPAC Name | N-[3-[1,4-dihydroxybutan-2-yl(methyl)amino]propyl]methanesulfonamide |
| SMILES | CN(CCCNS(C)(=O)=O)C(CO)CCO |
| InChI | InChI=1S/C9H22N2O4S/c1-11(9(8-13)4-7-12)6-3-5-10-16(2,14)15/h9-10,12-13H,3-8H2,1-2H3 |
| InChIKey | VWEABJAKJPATEV-UHFFFAOYSA-N |
| XLogP | -1.40 |
| TPSA | 89.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 254.35 |
| LogP ≤ 5 | -1.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N-[3-[1,4-dihydroxybutan-2-yl(methyl)amino]propyl]methanesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[3-[1,4-dihydroxybutan-2-yl(methyl)amino]propyl]methanesulfonamide?
The IUPAC name of N-[3-[1,4-dihydroxybutan-2-yl(methyl)amino]propyl]methanesulfonamide (CID 23542741) is N-[3-[1,4-dihydroxybutan-2-yl(methyl)amino]propyl]methanesulfonamide.
What is the SMILES notation for N-[3-[1,4-dihydroxybutan-2-yl(methyl)amino]propyl]methanesulfonamide?
The canonical SMILES for N-[3-[1,4-dihydroxybutan-2-yl(methyl)amino]propyl]methanesulfonamide is CN(CCCNS(C)(=O)=O)C(CO)CCO.
What is the InChIKey of N-[3-[1,4-dihydroxybutan-2-yl(methyl)amino]propyl]methanesulfonamide?
The InChIKey is VWEABJAKJPATEV-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H22N2O4S/c1-11(9(8-13)4-7-12)6-3-5-10-16(2,14)15/h9-10,12-13H,3-8H2,1-2H3.
What are the key properties of N-[3-[1,4-dihydroxybutan-2-yl(methyl)amino]propyl]methanesulfonamide?
N-[3-[1,4-dihydroxybutan-2-yl(methyl)amino]propyl]methanesulfonamide has a molecular weight of 254.35 g/mol, XLogP of -1.40, 9 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-[3-[1,4-dihydroxybutan-2-yl(methyl)amino]propyl]methanesulfonamide is sourced from PubChem (CID 23542741), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).