C12H2F20O5 — CID 23542758
[difluoro-[4-fluoro-2,2-bis(trifluoromethyl)-1,3-dioxolan-4-yl]methyl] 2,3,3,3-tetrafluoro-2-(1,1,2,2,3,3,3-heptafluoropropoxy)propanoate (PubChem CID 23542758) has the molecular formula C12H2F20O5 and a molecular weight of 606.10 g/mol. Its IUPAC name is [difluoro-[4-fluoro-2,2-bis(trifluoromethyl)-1,3-dioxolan-4-yl]methyl] 2,3,3,3-tetrafluoro-2-(1,1,2,2,3,3,3-heptafluoropropoxy)propanoate.
| Compound Name | [difluoro-[4-fluoro-2,2-bis(trifluoromethyl)-1,3-dioxolan-4-yl]methyl] 2,3,3,3-tetrafluoro-2-(1,1,2,2,3,3,3-heptafluoropropoxy)propanoate |
|---|---|
| PubChem CID | 23542758 |
| Molecular Formula | C12H2F20O5 |
| Molecular Weight | 606.10 g/mol |
| Exact Mass | 605.96 |
| IUPAC Name | [difluoro-[4-fluoro-2,2-bis(trifluoromethyl)-1,3-dioxolan-4-yl]methyl] 2,3,3,3-tetrafluoro-2-(1,1,2,2,3,3,3-heptafluoropropoxy)propanoate |
| SMILES | O=C(OC(F)(F)C1(F)COC(C(F)(F)F)(C(F)(F)F)O1)C(F)(OC(F)(F)C(F)(F)C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C12H2F20O5/c13-3(1-34-6(36-3,9(23,24)25)10(26,27)28)11(29,30)35-2(33)4(14,7(17,18)19)37-12(31,32)5(15,16)8(20,21)22/h1H2 |
| InChIKey | RXPAGMXNBZAUAM-UHFFFAOYSA-N |
| XLogP | 5.69 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 606.10 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|