C27H40N2O9 — CID 23543161
propan-2-yl [(2R,3S,4S,5R,6S)-3,4,5-trihydroxy-6-[5-methyl-1-propan-2-yl-4-[(4-propan-2-yloxyphenyl)methyl]pyrazol-3-yl]oxyoxan-2-yl]methyl carbonate (PubChem CID 23543161) has the molecular formula C27H40N2O9 and a molecular weight of 536.62 g/mol. Its IUPAC name is propan-2-yl [(2R,3S,4S,5R,6S)-3,4,5-trihydroxy-6-[5-methyl-1-propan-2-yl-4-[(4-propan-2-yloxyphenyl)methyl]pyrazol-3-yl]oxyoxan-2-yl]methyl carbonate.
| Compound Name | propan-2-yl [(2R,3S,4S,5R,6S)-3,4,5-trihydroxy-6-[5-methyl-1-propan-2-yl-4-[(4-propan-2-yloxyphenyl)methyl]pyrazol-3-yl]oxyoxan-2-yl]methyl carbonate |
|---|---|
| PubChem CID | 23543161 |
| Molecular Formula | C27H40N2O9 |
| Molecular Weight | 536.62 g/mol |
| Exact Mass | 536.27 |
| IUPAC Name | propan-2-yl [(2R,3S,4S,5R,6S)-3,4,5-trihydroxy-6-[5-methyl-1-propan-2-yl-4-[(4-propan-2-yloxyphenyl)methyl]pyrazol-3-yl]oxyoxan-2-yl]methyl carbonate |
| SMILES | Cc1c(Cc2ccc(OC(C)C)cc2)c(O[C@@H]2O[C@H](COC(=O)OC(C)C)[C@@H](O)[C@H](O)[C@H]2O)nn1C(C)C |
| InChI | InChI=1S/C27H40N2O9/c1-14(2)29-17(7)20(12-18-8-10-19(11-9-18)35-15(3)4)25(28-29)38-26-24(32)23(31)22(30)21(37-26)13-34-27(33)36-16(5)6/h8-11,14-16,21-24,26,30-32H,12-13H2,1-7H3/t21-,22-,23+,24-,26+/m1/s1 |
| InChIKey | QAAHWGQXOHLNFL-XCVFGXLCSA-N |
| XLogP | 2.90 |
| TPSA | 141.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.62 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |